6,7-Dimethoxy-2-((4'-(3-((4-(phenylsulfinyl)-1,2,5-oxadiazol-3-yl)oxy)propoxy)biphen-4-yl)methyl)-1,2,3,4-tetrahydroisoquinoline

ID: ALA4547419

PubChem CID: 155553476

Max Phase: Preclinical

Molecular Formula: C35H35N3O6S

Molecular Weight: 625.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)CN(Cc1ccc(-c3ccc(OCCCOc4nonc4[S+]([O-])c4ccccc4)cc3)cc1)CC2

Standard InChI:  InChI=1S/C35H35N3O6S/c1-40-32-21-28-17-18-38(24-29(28)22-33(32)41-2)23-25-9-11-26(12-10-25)27-13-15-30(16-14-27)42-19-6-20-43-34-35(37-44-36-34)45(39)31-7-4-3-5-8-31/h3-5,7-16,21-22H,6,17-20,23-24H2,1-2H3

Standard InChI Key:  NQYXUEQNOKDVCE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 45 50  0  0  0  0  0  0  0  0999 V2000
    2.8505  -20.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8494  -21.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5574  -22.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5556  -20.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2642  -20.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2676  -21.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9800  -22.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6936  -21.7160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6902  -20.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9732  -20.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4024  -22.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1090  -21.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8139  -22.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5200  -21.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5182  -20.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8044  -20.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1012  -20.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2208  -20.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9304  -20.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6360  -20.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6331  -19.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9188  -19.2551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2161  -19.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3386  -19.2483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0485  -19.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7540  -19.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4639  -19.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1694  -19.2330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8793  -19.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9650  -20.4497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7652  -20.6153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1700  -19.9054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6199  -19.3012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1413  -22.1278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4339  -21.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1427  -20.4918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4351  -20.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7845  -18.5007    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.5600  -18.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1736  -17.9580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1683  -18.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9432  -18.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1084  -17.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4926  -17.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7201  -17.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 29  1  0
  2 34  1  0
 34 35  1  0
  1 36  1  0
 36 37  1  0
 33 38  1  0
 38 39  1  0
 38 40  1  0
 39 41  2  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 39  1  0
M  CHG  2  38   1  40  -1
M  END

Alternative Forms

  1. Parent:

    ALA4547419

    ---

Associated Targets(Human)

ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCG2 Tchem ATP-binding cassette sub-family G member 2 (4927 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCC1 Tchem Multidrug resistance-associated protein 1 (2587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

MDCK (10148 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 625.75Molecular Weight (Monoisotopic): 625.2247AlogP: 6.33#Rotatable Bonds: 13
Polar Surface Area: 102.14Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.70CX LogP: 6.15CX LogD: 5.67
Aromatic Rings: 5Heavy Atoms: 45QED Weighted: 0.11Np Likeness Score: -0.69

References

1. Guglielmo S, Lazzarato L, Contino M, Perrone MG, Chegaev K, Carrieri A, Fruttero R, Colabufo NA, Gasco A..  (2016)  Structure-Activity Relationship Studies on Tetrahydroisoquinoline Derivatives: [4'-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-ylmethyl)biphenyl-4-ol] (MC70) Conjugated through Flexible Alkyl Chains with Furazan Moieties Gives Rise to Potent and Selective Ligands of P-glycoprotein.,  59  (14): [PMID:27336199] [10.1021/acs.jmedchem.6b00252]

Source