(Z)-3-(furan-2-ylmethyl)-2-thioxo-5-((5-(3-(trifluoromethyl)phenyl)furan-2-yl)methylene)thiazolidin-4-one

ID: ALA4547476

Cas Number: 608147-05-3

PubChem CID: 1841399

Max Phase: Preclinical

Molecular Formula: C20H12F3NO3S2

Molecular Weight: 435.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1/C(=C/c2ccc(-c3cccc(C(F)(F)F)c3)o2)SC(=S)N1Cc1ccco1

Standard InChI:  InChI=1S/C20H12F3NO3S2/c21-20(22,23)13-4-1-3-12(9-13)16-7-6-14(27-16)10-17-18(25)24(19(28)29-17)11-15-5-2-8-26-15/h1-10H,11H2/b17-10-

Standard InChI Key:  XMXNXZPMWNMQTP-YVLHZVERSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   21.8626  -24.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8637  -23.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1490  -23.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4325  -23.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4353  -24.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1507  -24.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7173  -23.0450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6293  -22.2270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8220  -22.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4106  -22.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9637  -23.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4854  -21.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9691  -20.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7938  -20.6321    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.0475  -19.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3792  -19.3632    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7127  -19.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9277  -19.5955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3779  -18.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6627  -18.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5702  -17.3185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7646  -17.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3590  -17.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9139  -18.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8318  -19.5909    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.5785  -23.0439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2926  -23.4570    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.5792  -22.2190    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.2986  -22.6373    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  2  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 17 18  2  0
 16 19  1  0
 20 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 20  2  0
 15 25  2  0
  2 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
M  END

Associated Targets(Human)

ENTPD5 Tbio Ectonucleoside triphosphate diphosphohydrolase 5 (478 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pyrH Uridylate kinase (158 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.45Molecular Weight (Monoisotopic): 435.0211AlogP: 5.96#Rotatable Bonds: 4
Polar Surface Area: 46.59Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.25CX LogD: 5.25
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.37Np Likeness Score: -2.09

References

1.  (2012)  Entpd5 inhibitors, 

Source