The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,5-Dimethyl-3-(4-nitro-2-(trifluoromethyl)phenyl)-2-thioxo-1-(3-(trifluoromethyl)phenyl)imidazolidin-4-one ID: ALA4547536
PubChem CID: 155553612
Max Phase: Preclinical
Molecular Formula: C19H13F6N3O4
Molecular Weight: 461.32
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)C(=O)N(c2cccc(C(F)(F)F)c2)C(=O)N1c1ccc([N+](=O)[O-])cc1C(F)(F)F
Standard InChI: InChI=1S/C19H13F6N3O4/c1-17(2)15(29)26(11-5-3-4-10(8-11)18(20,21)22)16(30)27(17)14-7-6-12(28(31)32)9-13(14)19(23,24)25/h3-9H,1-2H3
Standard InChI Key: MQXIMHPTIAFQFK-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
35.6668 -4.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4918 -4.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7486 -3.5034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0793 -3.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4143 -3.5034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0781 -2.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9760 -4.9555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8332 -4.3232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6585 -5.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5298 -3.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1420 -3.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9265 -3.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0997 -2.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4825 -2.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7004 -2.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6318 -3.2514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4610 -2.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6770 -2.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0632 -2.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2387 -3.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0223 -3.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5385 -4.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3654 -4.9094 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.3236 -3.8493 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.1211 -4.6834 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.2726 -2.4863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6605 -3.0395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0997 -1.6797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1965 -4.6089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5851 -5.1629 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.9819 -4.8613 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.4086 -5.4042 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
4 6 2 0
2 7 2 0
1 8 1 0
1 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
3 10 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
5 16 1 0
12 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
26 27 2 0
26 28 1 0
19 26 1 0
21 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M CHG 2 26 1 28 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.32Molecular Weight (Monoisotopic): 461.0810AlogP: 5.38#Rotatable Bonds: 3Polar Surface Area: 83.76Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.01CX LogD: 5.01Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: -1.29
References 1. Bassetto M, Ferla S, Pertusati F, Kandil S, Westwell AD, Brancale A, McGuigan C.. (2016) Design and synthesis of novel bicalutamide and enzalutamide derivatives as antiproliferative agents for the treatment of prostate cancer., 118 [PMID:27131065 ] [10.1016/j.ejmech.2016.04.052 ]