3-(1,3-Benzodioxol-5-yl)-N-(4-pyridylmethyl)pyrazolo[1,5-a]pyrimidin-5-amine

ID: ALA4547553

PubChem CID: 24866033

Max Phase: Preclinical

Molecular Formula: C19H15N5O2

Molecular Weight: 345.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  c1cc(CNc2ccn3ncc(-c4ccc5c(c4)OCO5)c3n2)ccn1

Standard InChI:  InChI=1S/C19H15N5O2/c1-2-16-17(26-12-25-16)9-14(1)15-11-22-24-8-5-18(23-19(15)24)21-10-13-3-6-20-7-4-13/h1-9,11H,10,12H2,(H,21,23)

Standard InChI Key:  DJMJVMXMRFYVLC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 30  0  0  0  0  0  0  0  0999 V2000
   14.7204   -4.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7193   -4.9467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4273   -5.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4255   -3.7183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1341   -4.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1344   -4.9422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9131   -5.1950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3941   -4.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9126   -3.8704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1633   -3.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9639   -2.9256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8661   -1.7147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6175   -2.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0126   -3.7188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3050   -4.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5972   -3.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6006   -2.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8936   -2.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1851   -2.9018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1879   -3.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8954   -4.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6690   -1.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2166   -2.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9598   -1.8104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8716   -1.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0739   -0.8338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 23  1  0
 22 12  1  0
 12 13  2  0
 13 10  1  0
  9 10  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 22  1  0
M  END

Associated Targets(Human)

RET Tclin Tyrosine-protein kinase receptor RET (6732 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 345.36Molecular Weight (Monoisotopic): 345.1226AlogP: 3.13#Rotatable Bonds: 4
Polar Surface Area: 73.57Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.02CX LogP: 2.50CX LogD: 2.50
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.61Np Likeness Score: -1.23

References

1. Newton R, Waszkowycz B, Seewooruthun C, Burschowsky D, Richards M, Hitchin S, Begum H, Watson A, French E, Hamilton N, Jones S, Lin LY, Waddell I, Echalier A, Bayliss R, Jordan AM, Ogilvie D..  (2020)  Discovery and Optimization of wt-RET/KDR-Selective Inhibitors of RETV804M Kinase.,  11  (4): [PMID:32292556] [10.1021/acsmedchemlett.9b00615]

Source