2-(4-chloro-3-fluorobenzyl)-6-(2-((1-methyl-1H-pyrazol-5-yl)amino)pyrimidin-4-yl)isoindolin-1-one

ID: ALA4547563

PubChem CID: 155553718

Max Phase: Preclinical

Molecular Formula: C23H18ClFN6O

Molecular Weight: 448.89

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1nccc1Nc1nccc(-c2ccc3c(c2)C(=O)N(Cc2ccc(Cl)c(F)c2)C3)n1

Standard InChI:  InChI=1S/C23H18ClFN6O/c1-30-21(7-9-27-30)29-23-26-8-6-20(28-23)15-3-4-16-13-31(22(32)17(16)11-15)12-14-2-5-18(24)19(25)10-14/h2-11H,12-13H2,1H3,(H,26,28,29)

Standard InChI Key:  ZMLUAQUWPDOLDJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    6.9076   -3.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9064   -4.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6145   -4.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6127   -3.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2018   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2030   -2.1825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4960   -1.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7874   -2.1830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7902   -3.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4978   -3.4090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3213   -3.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3261   -4.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1061   -4.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5835   -3.8074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0984   -3.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3463   -2.3693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4007   -3.8026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8051   -3.0925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0841   -3.4156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872   -4.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6222   -3.0904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0265   -2.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6137   -1.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7923   -1.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3917   -2.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4269   -4.7197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6823   -5.4959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4996   -5.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7490   -4.7147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6483   -4.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0172   -0.9642    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.8437   -2.3767    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 12  2  0
 11  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1  5  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 14 17  1  0
 17 18  1  0
  9 19  1  0
 19 20  1  0
 18 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 18  1  0
 20 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 20  2  0
 26 30  1  0
 23 31  1  0
 22 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4547563

    ---

Associated Targets(Human)

MAPK1 Tchem MAP kinase ERK2 (25055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.89Molecular Weight (Monoisotopic): 448.1215AlogP: 4.57#Rotatable Bonds: 5
Polar Surface Area: 75.94Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.21CX Basic pKa: 3.06CX LogP: 4.24CX LogD: 4.24
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.72

References

1. Ji D, Zhang L, Zhu Q, Bai Y, Wu Y, Xu Y..  (2019)  Discovery of potent, orally bioavailable ERK1/2 inhibitors with isoindolin-1-one structure by structure-based drug design.,  164  [PMID:30605831] [10.1016/j.ejmech.2018.12.040]

Source