The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((3-Methoxy-9-(3,4,5-trimethoxyphenyl)-6,7-dihydro-5H-benzo[7]annulen-4-yl)oxy)ethan-1-ol ID: ALA4547567
PubChem CID: 146373868
Max Phase: Preclinical
Molecular Formula: C23H28O6
Molecular Weight: 400.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C2=CCCCc3c2ccc(OC)c3OCCO)cc(OC)c1OC
Standard InChI: InChI=1S/C23H28O6/c1-25-19-10-9-17-16(7-5-6-8-18(17)22(19)29-12-11-24)15-13-20(26-2)23(28-4)21(14-15)27-3/h7,9-10,13-14,24H,5-6,8,11-12H2,1-4H3
Standard InChI Key: ZJUOBVLONOOXJS-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
18.7114 -25.1224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7103 -25.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4225 -26.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1363 -25.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1334 -25.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4207 -24.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4210 -27.1853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1575 -27.5393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3413 -28.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8362 -28.9866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0160 -28.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4987 -28.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6806 -27.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0790 -26.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2952 -27.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1165 -28.0356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7195 -28.5897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4182 -23.8922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1288 -23.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8437 -24.7075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5571 -25.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9995 -24.7140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9993 -23.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5409 -29.3871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3326 -28.2803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7309 -27.7232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7569 -29.6353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1515 -29.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3674 -29.3218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
7 13 1 0
9 10 1 0
10 11 1 0
12 11 1 0
3 7 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
6 18 1 0
18 19 1 0
5 20 1 0
20 21 1 0
1 22 1 0
22 23 1 0
17 24 1 0
16 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.47Molecular Weight (Monoisotopic): 400.1886AlogP: 3.86#Rotatable Bonds: 8Polar Surface Area: 66.38Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.55CX LogD: 3.55Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.73Np Likeness Score: 0.74
References 1. Niu H, Strecker TE, Gerberich JL, Campbell JW, Saha D, Mondal D, Hamel E, Chaplin DJ, Mason RP, Trawick ML, Pinney KG.. (2019) Structure Guided Design, Synthesis, and Biological Evaluation of Novel Benzosuberene Analogues as Inhibitors of Tubulin Polymerization., 62 (11): [PMID:31059248 ] [10.1021/acs.jmedchem.9b00551 ]