2-(exo-3,5-Dioxo-4-aza-tricyclo[5.2.1.0(2,6)]dec-4-yl)-N-((1R,9R,10S)-10-hydroxy-12-oxa-8-aza-tricyclo[7.3.1.0(2,7)]trideca-2(7),3,5-trien-4-ylmethyl)-acetamide

ID: ALA4547673

PubChem CID: 140430653

Max Phase: Preclinical

Molecular Formula: C23H27N3O5

Molecular Weight: 425.49

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  O=C(CN1C(=O)[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1=O)NCc1ccc2c(c1)[C@H]1C[C@@H](N2)[C@H](O)CO1

Standard InChI:  InChI=1S/C23H27N3O5/c27-17-10-31-18-7-16(17)25-15-4-1-11(5-14(15)18)8-24-19(28)9-26-22(29)20-12-2-3-13(6-12)21(20)23(26)30/h1,4-5,12-13,16-18,20-21,25,27H,2-3,6-10H2,(H,24,28)/t12-,13+,16-,17-,18-,20+,21-/m1/s1

Standard InChI Key:  BOGJVTQQRCPUBE-MZBUVPGESA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   33.3706  -21.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0884  -21.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0861  -20.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3706  -19.8676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6565  -21.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6597  -20.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9540  -19.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2389  -20.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2357  -21.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9456  -21.5191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.5204  -20.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5201  -19.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2354  -19.4514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8051  -21.0975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7957  -19.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5126  -20.2738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.2265  -19.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9433  -20.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2256  -19.0348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6594  -19.8540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4091  -20.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7376  -19.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5471  -18.8509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9577  -19.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7777  -19.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1911  -18.8509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7783  -18.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9502  -18.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5930  -20.9856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1275  -18.4791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6644  -18.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2754  -21.9280    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.8970  -19.0510    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.1930  -20.2779    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.8708  -17.3154    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.3068  -20.3148    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.3657  -18.0458    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  9 11  1  0
  7 13  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  6
  3 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
 20 21  1  0
 24 21  1  0
 23 22  1  0
 22 20  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 21 29  2  0
 22 30  2  0
 28 31  1  0
 25 31  1  0
  9 32  1  6
  7 33  1  6
 25 34  1  6
 28 35  1  6
 24 36  1  1
 23 37  1  1
M  END

Alternative Forms

1. Parent:

   

   ALA4547673

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 425.49

Molecular Weight (Monoisotopic): 425.1951

AlogP: 0.95

#Rotatable Bonds: 4

Polar Surface Area: 107.97

Molecular Species: NEUTRAL

HBA: 6

HBD: 3

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 3

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 13.78

CX Basic pKa: 2.87

CX LogP: -0.42

CX LogD: -0.42

Aromatic Rings: 1

Heavy Atoms: 31

QED Weighted: 0.62

Np Likeness Score: -0.12

References

1. Grädler U, Schwarz D, Blaesse M, Leuthner B, Johnson TL, Bernard F, Jiang X, Marx A, Gilardone M, Lemoine H, Roche D, Jorand-Lebrun C..  (2019)  Discovery of novel Cyclophilin D inhibitors starting from three dimensional fragments with millimolar potencies.,  29  (23): [PMID:31635932] [10.1016/j.bmcl.2019.126717]

2. Gaali, Steffen S, Kozany, Christian C, Hoogeland, Bastiaan B, Klein, Marielle M and Hausch, Felix F.  2010-12-09  Facile synthesis of a fluorescent cyclosporin a analogue to study cyclophilin 40 and cyclophilin 18 ligands.  [PMID:24900244]

3. Shore, Emma R ER and 12 more authors.  2016-03-24  Small Molecule Inhibitors of Cyclophilin D To Protect Mitochondrial Function as a Potential Treatment for Acute Pancreatitis.  [PMID:26950392]

4. Valasani, Koteswara Rao KR and 8 more authors.  2016-03-10  Identification of a Small Molecule Cyclophilin D Inhibitor for Rescuing Aβ-Mediated Mitochondrial Dysfunction.  [PMID:26985318]

Source

Source(1):

• Scientific Literature