1-(4-Chlorophenyl)-2-imino-10-methyl-N-(3-morpholinopropyl)-5-oxo-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide

ID: ALA4547715

PubChem CID: 155553359

Max Phase: Preclinical

Molecular Formula: C26H27ClN6O3

Molecular Weight: 506.99

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccn2c(=O)c3cc(C(=O)NCCCN4CCOCC4)c(=N)n(-c4ccc(Cl)cc4)c3nc12

Standard InChI:  InChI=1S/C26H27ClN6O3/c1-17-4-2-11-32-23(17)30-24-21(26(32)35)16-20(22(28)33(24)19-7-5-18(27)6-8-19)25(34)29-9-3-10-31-12-14-36-15-13-31/h2,4-8,11,16,28H,3,9-10,12-15H2,1H3,(H,29,34)

Standard InChI Key:  HAEFXCTVCZUTRD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   14.6806  -13.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6806  -14.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3900  -15.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3900  -13.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0994  -13.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1004  -14.6228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7965  -15.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7944  -13.3897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5156  -13.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5159  -14.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2257  -15.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9397  -14.6224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9394  -13.7991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2251  -13.3876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3900  -12.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7957  -15.8537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6515  -13.3910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6511  -15.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6502  -15.8572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3633  -14.6239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0748  -15.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7870  -14.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4943  -15.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2066  -14.6268    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9161  -15.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6262  -14.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6313  -13.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9200  -13.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2037  -13.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2237  -12.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9350  -12.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9339  -11.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2213  -10.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5084  -11.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5130  -12.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2188  -10.1114    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  2  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  4 15  1  0
  7 16  2  0
 13 17  2  0
 12 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 14 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4547715

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.99Molecular Weight (Monoisotopic): 506.1833AlogP: 2.53#Rotatable Bonds: 6
Polar Surface Area: 104.72Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.04CX LogP: 1.96CX LogD: 1.80
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.77

References

1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG..  (2020)  Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer.,  63  (9): [PMID:32297747] [10.1021/acs.jmedchem.0c00161]

Source