The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3-Chloro-4-methoxy-5-((1-(pyrimidin-2-yl)cyclopropyl)carbamoyl)phenyl)-6-(N-ethylmethylsulfonamido)-2-(4-fluorophenyl)-N-methylbenzofuran-3-carboxamide ID: ALA4547789
PubChem CID: 155553685
Max Phase: Preclinical
Molecular Formula: C34H31ClFN5O6S
Molecular Weight: 692.17
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(c1cc2oc(-c3ccc(F)cc3)c(C(=O)NC)c2cc1-c1cc(Cl)c(OC)c(C(=O)NC2(c3ncccn3)CC2)c1)S(C)(=O)=O
Standard InChI: InChI=1S/C34H31ClFN5O6S/c1-5-41(48(4,44)45)26-18-27-23(28(32(43)37-2)29(47-27)19-7-9-21(36)10-8-19)17-22(26)20-15-24(30(46-3)25(35)16-20)31(42)40-34(11-12-34)33-38-13-6-14-39-33/h6-10,13-18H,5,11-12H2,1-4H3,(H,37,43)(H,40,42)
Standard InChI Key: KATMITIMPSRCKL-UHFFFAOYSA-N
Molfile:
RDKit 2D
48 53 0 0 0 0 0 0 0 0999 V2000
33.6534 -24.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2448 -23.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8359 -24.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6156 -25.5393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7942 -25.5393 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.2070 -26.2511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1096 -22.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1085 -23.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8207 -23.4949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5344 -23.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5316 -22.2545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8189 -21.8492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9581 -23.0791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6706 -23.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3818 -23.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6719 -24.3120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0930 -23.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7996 -23.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7987 -22.2545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0854 -21.8472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3776 -22.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5118 -23.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5105 -24.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2220 -24.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2188 -23.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9308 -23.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9382 -24.3063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7234 -24.5524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2030 -23.8814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7115 -23.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0223 -23.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4366 -24.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2572 -24.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6643 -23.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2408 -23.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4217 -23.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9571 -22.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7590 -22.2585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4048 -21.8332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6503 -21.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4856 -23.8510 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.7985 -24.7187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0910 -24.3098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3789 -24.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0902 -25.9524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6636 -21.8537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6593 -21.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0812 -21.0258 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 2 1 0
2 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 15 1 0
18 22 1 0
22 23 2 0
23 24 1 0
24 27 2 0
26 25 2 0
25 22 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 26 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
29 31 1 0
30 37 1 0
37 38 2 0
37 39 1 0
39 40 1 0
34 41 1 0
23 42 1 0
42 43 1 0
43 44 1 0
42 5 1 0
5 45 1 0
21 46 1 0
46 47 1 0
20 48 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 692.17Molecular Weight (Monoisotopic): 691.1668AlogP: 5.92#Rotatable Bonds: 10Polar Surface Area: 143.73Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.83CX Basic pKa: 1.11CX LogP: 3.86CX LogD: 3.86Aromatic Rings: 5Heavy Atoms: 48QED Weighted: 0.18Np Likeness Score: -0.93
References 1. Yeung KS, Beno BR, Mosure K, Zhu J, Grant-Young KA, Parcella K, Anjanappa P, Bora RO, Selvakumar K, Wang YK, Fang H, Krause R, Rigat K, Liu M, Lemm J, Sheriff S, Witmer M, Tredup J, Jardel A, Kish K, Parker D, Haskell R, Santone K, Meanwell NA, Soars MG, Roberts SB, Kadow JF.. (2018) Structure-Property Basis for Solving Transporter-Mediated Efflux and Pan-Genotypic Inhibition in HCV NS5B Inhibitors., 9 (12): [PMID:30613329 ] [10.1021/acsmedchemlett.8b00379 ]