The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-Benzylpiperidin-4-yl)-7-benzyloxy-2-(4-phenylpiperazin-1-yl)quinazolin-4-amine ID: ALA4547807
PubChem CID: 122580326
Max Phase: Preclinical
Molecular Formula: C37H40N6O
Molecular Weight: 584.77
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(COc2ccc3c(NC4CCN(Cc5ccccc5)CC4)nc(N4CCN(c5ccccc5)CC4)nc3c2)cc1
Standard InChI: InChI=1S/C37H40N6O/c1-4-10-29(11-5-1)27-41-20-18-31(19-21-41)38-36-34-17-16-33(44-28-30-12-6-2-7-13-30)26-35(34)39-37(40-36)43-24-22-42(23-25-43)32-14-8-3-9-15-32/h1-17,26,31H,18-25,27-28H2,(H,38,39,40)
Standard InChI Key: ZKIYGBINMVHWDJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 50 0 0 0 0 0 0 0 0999 V2000
5.4218 -4.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4206 -5.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1287 -5.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1269 -3.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8355 -4.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8362 -5.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5448 -5.6014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2530 -5.1906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2483 -4.3685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5392 -3.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5349 -3.1479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2404 -2.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9456 -3.1431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6490 -2.7301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6489 -1.9126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9392 -1.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2296 -1.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9623 -5.5965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3560 -1.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0643 -1.9146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9612 -6.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6664 -6.8159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3750 -6.4081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3738 -5.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6640 -5.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0636 -2.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7711 -3.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7672 -1.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4794 -1.9055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4823 -2.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0802 -6.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0789 -7.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7859 -8.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4986 -7.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4959 -6.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7843 -6.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7126 -5.6065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0052 -5.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2972 -5.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5905 -5.1941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8789 -5.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8778 -6.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5943 -6.8285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2989 -6.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
8 18 1 0
15 19 1 0
19 20 1 0
18 21 1 0
18 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
20 26 2 0
26 27 1 0
27 30 2 0
29 28 2 0
28 20 1 0
29 30 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
23 31 1 0
2 37 1 0
37 38 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 584.77Molecular Weight (Monoisotopic): 584.3264AlogP: 6.61#Rotatable Bonds: 9Polar Surface Area: 56.76Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.71CX LogP: 7.34CX LogD: 5.91Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.21Np Likeness Score: -1.27
References 1. Bouchut A, Rotili D, Pierrot C, Valente S, Lafitte S, Schultz J, Hoglund U, Mazzone R, Lucidi A, Fabrizi G, Pechalrieu D, Arimondo PB, Skinner-Adams TS, Chua MJ, Andrews KT, Mai A, Khalife J.. (2019) Identification of novel quinazoline derivatives as potent antiplasmodial agents., 161 [PMID:30366254 ] [10.1016/j.ejmech.2018.10.041 ]