The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(8-hydroxyquinolin-5-yl)-3-{2-methyl-1H-benzo[d]imidazole-1-yl}propanamide ID: ALA4547811
PubChem CID: 155553728
Max Phase: Preclinical
Molecular Formula: C20H18N4O2
Molecular Weight: 346.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2ccccc2n1CCC(=O)Nc1ccc(O)c2ncccc12
Standard InChI: InChI=1S/C20H18N4O2/c1-13-22-16-6-2-3-7-17(16)24(13)12-10-19(26)23-15-8-9-18(25)20-14(15)5-4-11-21-20/h2-9,11,25H,10,12H2,1H3,(H,23,26)
Standard InChI Key: LKUPDFVBMOASDZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
16.6015 -9.8942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8852 -10.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1696 -9.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4615 -10.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3120 -10.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3042 -11.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0138 -11.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7280 -11.1285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0178 -9.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7247 -10.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4303 -9.8972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4302 -9.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7186 -8.6725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0160 -9.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4398 -11.5412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8846 -11.1235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7500 -9.8919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6622 -9.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8588 -8.9073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9960 -10.2265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4459 -9.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6444 -9.7883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3920 -10.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9472 -11.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7425 -11.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2687 -8.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 2 0
8 15 1 0
2 16 2 0
4 17 1 0
17 18 1 0
18 19 2 0
19 21 1 0
20 17 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
18 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 346.39Molecular Weight (Monoisotopic): 346.1430AlogP: 3.63#Rotatable Bonds: 4Polar Surface Area: 80.04Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.80CX Basic pKa: 6.18CX LogP: 2.61CX LogD: 2.57Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.55Np Likeness Score: -1.68
References 1. Chen C, Yang X, Fang H, Hou X.. (2019) Design, synthesis and preliminary bioactivity evaluations of 8-hydroxyquinoline derivatives as matrix metalloproteinase (MMP) inhibitors., 181 [PMID:31415980 ] [10.1016/j.ejmech.2019.111563 ]