The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cyclo[N-methyloxy-2-[(3,4,5-trimethyloxy)phenylmethylene]glycylprolyl] ID: ALA4547897
PubChem CID: 155553791
Max Phase: Preclinical
Molecular Formula: C18H22N2O6
Molecular Weight: 362.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C2\C(=O)N3CCC[C@H]3C(=O)N2OC)cc(OC)c1OC
Standard InChI: InChI=1S/C18H22N2O6/c1-23-14-9-11(10-15(24-2)16(14)25-3)8-13-17(21)19-7-5-6-12(19)18(22)20(13)26-4/h8-10,12H,5-7H2,1-4H3/b13-8+/t12-/m0/s1
Standard InChI Key: MWDBUVLYXZHSKN-OXBCTQFSSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
33.0591 -4.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0591 -5.7203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7644 -6.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7644 -4.4904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4697 -4.9031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4696 -5.7214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2478 -5.9743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7288 -5.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2478 -4.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7644 -3.6732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7639 -6.9420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3502 -4.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3478 -3.6794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0541 -3.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0521 -2.4540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3426 -2.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6338 -2.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6393 -3.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3520 -6.1300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3391 -1.2295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0451 -0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7588 -2.0437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4675 -2.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9235 -2.0577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2184 -2.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3532 -6.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4624 -6.5375 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
4 10 2 0
3 11 2 0
1 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 19 1 0
16 20 1 0
20 21 1 0
15 22 1 0
22 23 1 0
17 24 1 0
24 25 1 0
19 26 1 0
6 27 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 362.38Molecular Weight (Monoisotopic): 362.1478AlogP: 1.45#Rotatable Bonds: 5Polar Surface Area: 77.54Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 0.66CX LogD: 0.66Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.74Np Likeness Score: 0.33
References 1. Tian X, Feng J, Fan SM, Zhen XL, Han JR, Liu SX.. (2016) Synthesis and activity evaluation of the cyclic dipeptides arylidene N-alkoxydiketopiperazines., 24 (21): [PMID:27594550 ] [10.1016/j.bmc.2016.08.038 ]