Cyclo[N-methyloxy-2-[(3,4,5-trimethyloxy)phenylmethylene]glycylprolyl]

ID: ALA4547897

PubChem CID: 155553791

Max Phase: Preclinical

Molecular Formula: C18H22N2O6

Molecular Weight: 362.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C2\C(=O)N3CCC[C@H]3C(=O)N2OC)cc(OC)c1OC

Standard InChI:  InChI=1S/C18H22N2O6/c1-23-14-9-11(10-15(24-2)16(14)25-3)8-13-17(21)19-7-5-6-12(19)18(22)20(13)26-4/h8-10,12H,5-7H2,1-4H3/b13-8+/t12-/m0/s1

Standard InChI Key:  MWDBUVLYXZHSKN-OXBCTQFSSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   33.0591   -4.9031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0591   -5.7203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7644   -6.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7644   -4.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4697   -4.9031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4696   -5.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2478   -5.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7288   -5.3123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2478   -4.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7644   -3.6732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7639   -6.9420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3502   -4.4966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3478   -3.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0541   -3.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0521   -2.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3426   -2.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6338   -2.4617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6393   -3.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3520   -6.1300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3391   -1.2295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0451   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7588   -2.0437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4675   -2.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9235   -2.0577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2184   -2.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3532   -6.9472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4624   -6.5375    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  4 10  2  0
  3 11  2  0
  1 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 19  1  0
 16 20  1  0
 20 21  1  0
 15 22  1  0
 22 23  1  0
 17 24  1  0
 24 25  1  0
 19 26  1  0
  6 27  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4547897

    ---

Associated Targets(Human)

CASP3 Tchem Caspase-3 (3632 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.38Molecular Weight (Monoisotopic): 362.1478AlogP: 1.45#Rotatable Bonds: 5
Polar Surface Area: 77.54Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 0.66CX LogD: 0.66
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.74Np Likeness Score: 0.33

References

1. Tian X, Feng J, Fan SM, Zhen XL, Han JR, Liu SX..  (2016)  Synthesis and activity evaluation of the cyclic dipeptides arylidene N-alkoxydiketopiperazines.,  24  (21): [PMID:27594550] [10.1016/j.bmc.2016.08.038]

Source