2-{4-[(1R)-1-[(4-chloro-1,6-dimethyl-1H-indol-2-yl)formamido]ethyl]benzenesulfinyl}acetic acid

ID: ALA4547905

PubChem CID: 142427804

Max Phase: Preclinical

Molecular Formula: C21H21ClN2O4S

Molecular Weight: 432.93

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(Cl)c2cc(C(=O)N[C@H](C)c3ccc([S+]([O-])CC(=O)O)cc3)n(C)c2c1

Standard InChI:  InChI=1S/C21H21ClN2O4S/c1-12-8-17(22)16-10-19(24(3)18(16)9-12)21(27)23-13(2)14-4-6-15(7-5-14)29(28)11-20(25)26/h4-10,13H,11H2,1-3H3,(H,23,27)(H,25,26)/t13-,29?/m1/s1

Standard InChI Key:  VBQXPKOVIPZVMB-RNHBAAACSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   16.2617  -10.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5377   -9.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5377   -8.7558    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.2617   -8.3504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8426   -8.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8426   -7.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1185   -7.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4234   -7.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4234   -8.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1185   -8.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6993   -7.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6993   -6.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9753   -7.5105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2802   -7.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2802   -6.2940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5562   -7.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4693   -8.3504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6873   -8.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2529   -9.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4419   -9.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0364   -8.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4419   -7.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2529   -7.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8031   -7.1919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0364   -7.0760    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.0364   -9.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0775   -8.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2617  -10.8122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9568   -9.5668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  8 11  1  0
 11 12  1  6
 11 13  1  0
 14 13  1  0
 14 15  2  0
 14 16  1  0
 17 16  1  0
 17 18  1  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 23 18  2  0
 24 23  1  0
 16 24  2  0
 22 25  1  0
 20 26  1  0
 17 27  1  0
  1 28  2  0
  1 29  1  0
M  CHG  2   3   1   4  -1
M  END

Alternative Forms

  1. Parent:

    ALA4547905

    ---

Associated Targets(Human)

PHGDH Tchem D-3-phosphoglycerate dehydrogenase (883 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.93Molecular Weight (Monoisotopic): 432.0911AlogP: 3.82#Rotatable Bonds: 6
Polar Surface Area: 94.39Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.69CX Basic pKa: CX LogP: 3.22CX LogD: -0.09
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.58Np Likeness Score: -1.00

References

1.  (2018)  Tosylacetate based compounds and derivatives thereof as phgdh inhibitors, 

Source