N-(5,6-dimethoxypyridin-2-yl)-5-methoxy-2,2-dimethyl-N-(2-(pyrrolidin-1-yl)ethyl)-2H-chromene-6-carboxamide

ID: ALA4547943

PubChem CID: 155554058

Max Phase: Preclinical

Molecular Formula: C26H33N3O5

Molecular Weight: 467.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(N(CCN2CCCC2)C(=O)c2ccc3c(c2OC)C=CC(C)(C)O3)nc1OC

Standard InChI:  InChI=1S/C26H33N3O5/c1-26(2)13-12-18-20(34-26)9-8-19(23(18)32-4)25(30)29(17-16-28-14-6-7-15-28)22-11-10-21(31-3)24(27-22)33-5/h8-13H,6-7,14-17H2,1-5H3

Standard InChI Key:  RIJXUCCMGLSFIZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   40.7151  -22.7493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8979  -22.7493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3065  -23.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2422  -19.4970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2411  -20.3165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9491  -20.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6588  -20.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6559  -19.4934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9473  -19.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9449  -18.2709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6514  -17.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5344  -19.0886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5342  -18.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3671  -20.7235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0742  -20.3138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7825  -20.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0729  -19.4966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7792  -21.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1908  -20.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4827  -20.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1947  -21.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4903  -21.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4908  -22.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1941  -23.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8997  -21.9365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0719  -21.9462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0726  -22.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3684  -21.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6613  -21.9504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6626  -22.7676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0064  -23.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2602  -24.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0774  -24.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3286  -23.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  1  0
  4 12  1  0
 12 13  1  0
  7 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  2  0
 18 22  1  0
 21 19  1  0
 19 20  2  0
 20 16  1  0
 21 22  2  0
 21 25  1  0
 22 23  1  0
 23 24  2  0
 24  2  1  0
  2 25  1  0
 18 26  1  0
 26 27  1  0
 14 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4547943

    ---

Associated Targets(Human)

HSP90AA1 Tchem Heat shock protein HSP90 (3606 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.57Molecular Weight (Monoisotopic): 467.2420AlogP: 4.03#Rotatable Bonds: 8
Polar Surface Area: 73.36Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.70CX LogP: 3.75CX LogD: 3.28
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.58Np Likeness Score: 0.01

References

1. Kim HS, Hoang VH, Hong M, Chul Kim K, Ann J, Nguyen CT, Seo JH, Choi H, Yong Kim J, Kim KW, Sub Byun W, Lee S, Lee S, Suh YG, Chen J, Park HJ, Cho TM, Kim JY, Seo JH, Lee J..  (2019)  Investigation of B,C-ring truncated deguelin derivatives as heat shock protein 90 (HSP90) inhibitors for use as anti-breast cancer agents.,  27  (7): [PMID:30827868] [10.1016/j.bmc.2019.02.040]

Source