The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5,6-dimethoxypyridin-2-yl)-5-methoxy-2,2-dimethyl-N-(2-(pyrrolidin-1-yl)ethyl)-2H-chromene-6-carboxamide ID: ALA4547943
PubChem CID: 155554058
Max Phase: Preclinical
Molecular Formula: C26H33N3O5
Molecular Weight: 467.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N(CCN2CCCC2)C(=O)c2ccc3c(c2OC)C=CC(C)(C)O3)nc1OC
Standard InChI: InChI=1S/C26H33N3O5/c1-26(2)13-12-18-20(34-26)9-8-19(23(18)32-4)25(30)29(17-16-28-14-6-7-15-28)22-11-10-21(31-3)24(27-22)33-5/h8-13H,6-7,14-17H2,1-5H3
Standard InChI Key: RIJXUCCMGLSFIZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
40.7151 -22.7493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8979 -22.7493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3065 -23.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2422 -19.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2411 -20.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9491 -20.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6588 -20.3161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6559 -19.4934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9473 -19.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9449 -18.2709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6514 -17.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5344 -19.0886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5342 -18.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3671 -20.7235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0742 -20.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7825 -20.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0729 -19.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7792 -21.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1908 -20.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4827 -20.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1947 -21.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4903 -21.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4908 -22.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1941 -23.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8997 -21.9365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0719 -21.9462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0726 -22.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3684 -21.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6613 -21.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6626 -22.7676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0064 -23.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2602 -24.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0774 -24.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3286 -23.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 1 0
4 12 1 0
12 13 1 0
7 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 2 0
18 22 1 0
21 19 1 0
19 20 2 0
20 16 1 0
21 22 2 0
21 25 1 0
22 23 1 0
23 24 2 0
24 2 1 0
2 25 1 0
18 26 1 0
26 27 1 0
14 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.57Molecular Weight (Monoisotopic): 467.2420AlogP: 4.03#Rotatable Bonds: 8Polar Surface Area: 73.36Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.70CX LogP: 3.75CX LogD: 3.28Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.58Np Likeness Score: 0.01
References 1. Kim HS, Hoang VH, Hong M, Chul Kim K, Ann J, Nguyen CT, Seo JH, Choi H, Yong Kim J, Kim KW, Sub Byun W, Lee S, Lee S, Suh YG, Chen J, Park HJ, Cho TM, Kim JY, Seo JH, Lee J.. (2019) Investigation of B,C-ring truncated deguelin derivatives as heat shock protein 90 (HSP90) inhibitors for use as anti-breast cancer agents., 27 (7): [PMID:30827868 ] [10.1016/j.bmc.2019.02.040 ]