The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(Benzofuran-2-carbonyl)-1-[(2-chloro-5-trifluoromethylphenyl)aminocarbonyl]-2,6-dimethylpiperazine ID: ALA4547967
PubChem CID: 155554166
Max Phase: Preclinical
Molecular Formula: C23H21ClF3N3O3
Molecular Weight: 479.89
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1CN(C(=O)c2cc3ccccc3o2)CC(C)N1C(=O)Nc1cc(C(F)(F)F)ccc1Cl
Standard InChI: InChI=1S/C23H21ClF3N3O3/c1-13-11-29(21(31)20-9-15-5-3-4-6-19(15)33-20)12-14(2)30(13)22(32)28-18-10-16(23(25,26)27)7-8-17(18)24/h3-10,13-14H,11-12H2,1-2H3,(H,28,32)
Standard InChI Key: UMVSJOSARWILIF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
35.1189 -9.5554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1178 -10.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8336 -10.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5470 -10.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5442 -9.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8318 -9.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4033 -9.1406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6878 -9.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9722 -9.1410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9704 -8.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2589 -7.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5410 -8.3074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5392 -9.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2553 -9.5530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8311 -7.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8340 -7.0685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1141 -8.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3565 -7.9663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8027 -8.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2129 -9.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0211 -9.1238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8006 -10.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9808 -10.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5698 -9.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9816 -8.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6860 -7.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6880 -10.3771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4065 -10.7944 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
37.2549 -9.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9670 -9.5495 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.2537 -8.3184 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.9610 -8.7249 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.2520 -10.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
9 14 1 0
12 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
20 19 2 0
20 21 1 0
21 17 2 0
22 20 1 0
23 22 2 0
24 23 1 0
25 24 2 0
19 25 1 0
10 26 1 0
8 27 2 0
2 28 1 0
5 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
14 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.89Molecular Weight (Monoisotopic): 479.1224AlogP: 5.87#Rotatable Bonds: 2Polar Surface Area: 65.79Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.91CX Basic pKa: ┄CX LogP: 4.65CX LogD: 4.65Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -1.56
References 1. Mazzotta S, Marrugal-Lorenzo JA, Vega-Holm M, Serna-Gallego A, Álvarez-Vidal J, Berastegui-Cabrera J, Pérez Del Palacio J, Díaz C, Aiello F, Pachón J, Iglesias-Guerra F, Vega-Pérez JM, Sánchez-Céspedes J.. (2020) Optimization of piperazine-derived ureas privileged structures for effective antiadenovirus agents., 185 [PMID:31711794 ] [10.1016/j.ejmech.2019.111840 ]