4-(Benzofuran-2-carbonyl)-1-[(2-chloro-5-trifluoromethylphenyl)aminocarbonyl]-2,6-dimethylpiperazine

ID: ALA4547967

PubChem CID: 155554166

Max Phase: Preclinical

Molecular Formula: C23H21ClF3N3O3

Molecular Weight: 479.89

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1CN(C(=O)c2cc3ccccc3o2)CC(C)N1C(=O)Nc1cc(C(F)(F)F)ccc1Cl

Standard InChI:  InChI=1S/C23H21ClF3N3O3/c1-13-11-29(21(31)20-9-15-5-3-4-6-19(15)33-20)12-14(2)30(13)22(32)28-18-10-16(23(25,26)27)7-8-17(18)24/h3-10,13-14H,11-12H2,1-2H3,(H,28,32)

Standard InChI Key:  UMVSJOSARWILIF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   35.1189   -9.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1178  -10.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8336  -10.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5470  -10.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5442   -9.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8318   -9.1402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4033   -9.1406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6878   -9.5557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9722   -9.1410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9704   -8.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2589   -7.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5410   -8.3074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5392   -9.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2553   -9.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8311   -7.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8340   -7.0685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1141   -8.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3565   -7.9663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8027   -8.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2129   -9.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0211   -9.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8006  -10.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9808  -10.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5698   -9.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9816   -8.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6860   -7.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6880  -10.3771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4065  -10.7944    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   37.2549   -9.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9670   -9.5495    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.2537   -8.3184    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.9610   -8.7249    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.2520  -10.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  9 14  1  0
 12 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 20 19  2  0
 20 21  1  0
 21 17  2  0
 22 20  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 19 25  1  0
 10 26  1  0
  8 27  2  0
  2 28  1  0
  5 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
 14 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4547967

    ---

Associated Targets(non-human)

Human adenovirus 5 (897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.89Molecular Weight (Monoisotopic): 479.1224AlogP: 5.87#Rotatable Bonds: 2
Polar Surface Area: 65.79Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.91CX Basic pKa: CX LogP: 4.65CX LogD: 4.65
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -1.56

References

1. Mazzotta S, Marrugal-Lorenzo JA, Vega-Holm M, Serna-Gallego A, Álvarez-Vidal J, Berastegui-Cabrera J, Pérez Del Palacio J, Díaz C, Aiello F, Pachón J, Iglesias-Guerra F, Vega-Pérez JM, Sánchez-Céspedes J..  (2020)  Optimization of piperazine-derived ureas privileged structures for effective antiadenovirus agents.,  185  [PMID:31711794] [10.1016/j.ejmech.2019.111840]

Source