The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-methoxyethyl 2-{4-[(1R)-1-[(1-methyl-3-phenyl-1H-pyrazol-5-yl)formamido]ethyl]benzenesulfonyl}acetate ID: ALA4548024
PubChem CID: 142427742
Max Phase: Preclinical
Molecular Formula: C24H27N3O6S
Molecular Weight: 485.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCOC(=O)CS(=O)(=O)c1ccc([C@@H](C)NC(=O)c2cc(-c3ccccc3)nn2C)cc1
Standard InChI: InChI=1S/C24H27N3O6S/c1-17(25-24(29)22-15-21(26-27(22)2)19-7-5-4-6-8-19)18-9-11-20(12-10-18)34(30,31)16-23(28)33-14-13-32-3/h4-12,15,17H,13-14,16H2,1-3H3,(H,25,29)/t17-/m1/s1
Standard InChI Key: BFGHKEDRUIISSM-QGZVFWFLSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
10.5121 -10.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6907 -11.7832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6949 -10.9660 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.9851 -11.3711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7471 -8.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7519 -9.2840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5319 -9.5325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0093 -8.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5242 -8.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8265 -8.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2392 -9.5678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2309 -8.1525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0481 -8.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4525 -7.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4608 -8.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0535 -9.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4656 -10.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2836 -10.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6878 -9.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2734 -8.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9282 -11.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7453 -11.6607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5247 -12.3772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7890 -10.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0832 -7.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7592 -7.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6807 -7.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3447 -8.3286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5048 -6.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1651 -7.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1590 -12.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9762 -12.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3899 -13.0643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2071 -13.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 2 0
10 12 1 0
13 12 1 6
13 14 1 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 3 1 0
3 1 1 0
1 21 1 0
21 22 1 0
21 23 2 0
7 24 1 0
5 25 1 0
25 30 2 0
29 26 2 0
26 27 1 0
27 28 2 0
28 25 1 0
29 30 1 0
22 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.56Molecular Weight (Monoisotopic): 485.1621AlogP: 2.54#Rotatable Bonds: 10Polar Surface Area: 116.59Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.73CX Basic pKa: 1.21CX LogP: 2.44CX LogD: 2.44Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -1.64
References 1. (2018) Tosylacetate based compounds and derivatives thereof as phgdh inhibitors,