2-methoxyethyl 2-{4-[(1R)-1-[(1-methyl-3-phenyl-1H-pyrazol-5-yl)formamido]ethyl]benzenesulfonyl}acetate

ID: ALA4548024

PubChem CID: 142427742

Max Phase: Preclinical

Molecular Formula: C24H27N3O6S

Molecular Weight: 485.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCOC(=O)CS(=O)(=O)c1ccc([C@@H](C)NC(=O)c2cc(-c3ccccc3)nn2C)cc1

Standard InChI:  InChI=1S/C24H27N3O6S/c1-17(25-24(29)22-15-21(26-27(22)2)19-7-5-4-6-8-19)18-9-11-20(12-10-18)34(30,31)16-23(28)33-14-13-32-3/h4-12,15,17H,13-14,16H2,1-3H3,(H,25,29)/t17-/m1/s1

Standard InChI Key:  BFGHKEDRUIISSM-QGZVFWFLSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   10.5121  -10.9578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6907  -11.7832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6949  -10.9660    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.9851  -11.3711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7471   -8.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7519   -9.2840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5319   -9.5325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0093   -8.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5242   -8.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8265   -8.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2392   -9.5678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2309   -8.1525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0481   -8.1476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4525   -7.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4608   -8.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0535   -9.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4656  -10.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2836  -10.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6878   -9.5479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2734   -8.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9282  -11.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7453  -11.6607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5247  -12.3772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7890  -10.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0832   -7.9890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7592   -7.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6807   -7.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3447   -8.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5048   -6.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1651   -7.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1590  -12.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9762  -12.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3899  -13.0643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2071  -13.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  2  0
 10 12  1  0
 13 12  1  6
 13 14  1  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18  3  1  0
  3  1  1  0
  1 21  1  0
 21 22  1  0
 21 23  2  0
  7 24  1  0
  5 25  1  0
 25 30  2  0
 29 26  2  0
 26 27  1  0
 27 28  2  0
 28 25  1  0
 29 30  1  0
 22 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548024

    ---

Associated Targets(Human)

PHGDH Tchem D-3-phosphoglycerate dehydrogenase (883 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.56Molecular Weight (Monoisotopic): 485.1621AlogP: 2.54#Rotatable Bonds: 10
Polar Surface Area: 116.59Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.73CX Basic pKa: 1.21CX LogP: 2.44CX LogD: 2.44
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -1.64

References

1.  (2018)  Tosylacetate based compounds and derivatives thereof as phgdh inhibitors, 

Source