3-(6-(hydroxymethyl)-1-((2,2,3,3-tetrafluorocyclopropyl)methyl)-1H-indol-3-yl)benzothioamide

ID: ALA4548031

PubChem CID: 132137140

Max Phase: Preclinical

Molecular Formula: C20H16F4N2OS

Molecular Weight: 408.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=S)c1cccc(-c2cn(CC3C(F)(F)C3(F)F)c3cc(CO)ccc23)c1

Standard InChI:  InChI=1S/C20H16F4N2OS/c21-19(22)17(20(19,23)24)9-26-8-15(12-2-1-3-13(7-12)18(25)28)14-5-4-11(10-27)6-16(14)26/h1-8,17,27H,9-10H2,(H2,25,28)

Standard InChI Key:  VVFONUIAFSPILK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   12.5096  -10.5740    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.7242   -9.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9342   -9.9939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.0491   -8.8694    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.4713   -9.4514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2642   -9.6608    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.8068   -8.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5536   -4.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5855   -5.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3142   -5.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0032   -5.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9673   -4.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2505   -3.8380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6653   -3.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3951   -4.1554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3552   -6.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6292   -2.9529    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.6881   -6.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9528   -7.5546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0185   -6.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7670   -7.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3148   -8.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1060   -7.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3629   -7.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8134   -6.6070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4696   -8.2249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6545   -8.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3926   -9.3710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 12 14  1  0
 14 15  1  0
 10 16  1  0
 14 17  2  0
 16 18  2  0
 18 19  1  0
 19 21  1  0
 20 16  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  1  0
 23 27  1  0
 27 28  1  0
 26  7  1  0
  2  7  1  0
  5  2  1  0
  7  5  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548031

    ---

Associated Targets(Human)

ASH1L Tbio Histone-lysine N-methyltransferase ASH1L (468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 408.42Molecular Weight (Monoisotopic): 408.0919AlogP: 4.34#Rotatable Bonds: 5
Polar Surface Area: 51.18Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.68CX Basic pKa: CX LogP: 4.15CX LogD: 4.15
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.49Np Likeness Score: -0.35

References

1.  (2017)  Ash1l inhibitors and methods of treatment therewith, 

Source