(S)-5-(4-Morpholino-5a,6,8,9-tetrahydro-5H-pyrimido-[5',4':4,5]pyrrolo[2,1-c][1,4]oxazin-2-yl)-4-(trifluoromethyl)-pyridin-2-amine

ID: ALA4548051

PubChem CID: 118000139

Max Phase: Preclinical

Molecular Formula: C19H21F3N6O2

Molecular Weight: 422.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)c3c(n2)N2CCOC[C@@H]2C3)cn1

Standard InChI:  InChI=1S/C19H21F3N6O2/c20-19(21,22)14-8-15(23)24-9-13(14)16-25-17(27-1-4-29-5-2-27)12-7-11-10-30-6-3-28(11)18(12)26-16/h8-9,11H,1-7,10H2,(H2,23,24)/t11-/m0/s1

Standard InChI Key:  VEUJAZRDHNBJQE-NSHDSACASA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   29.0369  -15.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7408  -15.5479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4449  -15.9545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4449  -16.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7433  -17.1764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0369  -16.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2579  -17.0267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7737  -16.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2580  -15.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9601  -16.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6266  -17.1978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1066  -17.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9244  -17.7740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3639  -15.6531    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.1526  -17.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8647  -16.7701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5688  -17.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5688  -17.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8673  -18.4080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1526  -18.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2807  -18.4090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8647  -15.9504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1529  -15.5406    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.5724  -15.5406    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.8647  -15.1307    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.7408  -14.7282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0331  -14.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0331  -13.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7408  -13.0889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4526  -13.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4526  -14.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  1  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  7 13  1  0
  8 14  1  1
 15  4  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 18 21  1  0
 16 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
  2 26  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 26 31  1  0
M  END

Associated Targets(Human)

PIK3R1 Tchem PI3-kinase p110-alpha/p85-alpha (2589 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MTOR Tclin mTORC2 (162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MTOR Tclin mTORC1 (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.41Molecular Weight (Monoisotopic): 422.1678AlogP: 1.74#Rotatable Bonds: 2
Polar Surface Area: 89.63Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.06CX LogP: 3.05CX LogD: 3.03
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.78Np Likeness Score: -0.71

References

1. Borsari C, Rageot D, Dall'Asen A, Bohnacker T, Melone A, Sele AM, Jackson E, Langlois JB, Beaufils F, Hebeisen P, Fabbro D, Hillmann P, Wymann MP..  (2019)  A Conformational Restriction Strategy for the Identification of a Highly Selective Pyrimido-pyrrolo-oxazine mTOR Inhibitor.,  62  (18): [PMID:31465220] [10.1021/acs.jmedchem.9b00972]

Source