(E)-3-(2-oxo-1-(3-(trifluoromethyl)phenyl)-1,2-dihydrooxazolo[5,4-c]quinolin-8-yl)acrylonitrile

ID: ALA4548073

PubChem CID: 155249661

Max Phase: Preclinical

Molecular Formula: C20H10F3N3O2

Molecular Weight: 381.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#C/C=C/c1ccc2ncc3oc(=O)n(-c4cccc(C(F)(F)F)c4)c3c2c1

Standard InChI:  InChI=1S/C20H10F3N3O2/c21-20(22,23)13-4-1-5-14(10-13)26-18-15-9-12(3-2-8-24)6-7-16(15)25-11-17(18)28-19(26)27/h1-7,9-11H/b3-2+

Standard InChI Key:  SVBCFEOXIVKCIH-NSCUHMNNSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    4.6624  -25.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6612  -26.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3693  -27.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3675  -25.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0761  -25.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0768  -26.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7854  -27.1827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4936  -26.7719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7786  -25.5420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4855  -25.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0904  -25.4018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7575  -24.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9468  -24.7442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1648  -23.9490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4013  -24.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6541  -23.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1070  -22.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3070  -22.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0570  -23.7099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6058  -24.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3585  -21.9788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1576  -21.8079    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.8109  -21.3723    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.7604  -21.2676    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9545  -25.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2469  -25.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5391  -25.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8280  -25.1424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 12 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 17 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
  1 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4548073

    ---

Associated Targets(Human)

RD (1212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Enterovirus A71 (1246 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 381.31Molecular Weight (Monoisotopic): 381.0725AlogP: 4.69#Rotatable Bonds: 2
Polar Surface Area: 71.82Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.68CX LogP: 4.28CX LogD: 4.28
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.47Np Likeness Score: -1.06

References

1. Hao T, Li Y, Fan S, Li W, Wang S, Li S, Cao R, Zhong W..  (2019)  Design, synthesis and pharmacological evaluation of a novel mTOR-targeted anti-EV71 agent.,  175  [PMID:31082764] [10.1016/j.ejmech.2019.04.048]

Source