3-(6-(hydroxymethyl)-1-(4,4,4-trifluorobutyl)-1H-indol-3-yl)benzothioamide

ID: ALA4548146

PubChem CID: 132118139

Max Phase: Preclinical

Molecular Formula: C20H19F3N2OS

Molecular Weight: 392.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=S)c1cccc(-c2cn(CCCC(F)(F)F)c3cc(CO)ccc23)c1

Standard InChI:  InChI=1S/C20H19F3N2OS/c21-20(22,23)7-2-8-25-11-17(14-3-1-4-15(10-14)19(24)27)16-6-5-13(12-26)9-18(16)25/h1,3-6,9-11,26H,2,7-8,12H2,(H2,24,27)

Standard InChI Key:  PBHJPYXZRNIHCE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   13.8447   -5.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8434   -5.9732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5583   -6.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2747   -5.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2719   -5.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5565   -4.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9848   -4.7270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7008   -5.1369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5581   -7.2112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9817   -3.9020    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.8929   -7.6922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1476   -8.4769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2277   -7.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9739   -8.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5227   -9.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3256   -8.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5767   -8.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0260   -7.5202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6640   -9.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0010   -9.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5174  -10.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8793   -9.5220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8544  -11.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3708  -11.9882    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.6751  -11.4044    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.2627  -12.0293    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.6858   -9.3481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  3  9  1  0
  7 10  2  0
  9 11  2  0
 11 12  1  0
 12 14  1  0
 13  9  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 12 19  1  0
 19 20  1  0
 20 21  1  0
 16 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
 22 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548146

    ---

Associated Targets(Human)

ASH1L Tbio Histone-lysine N-methyltransferase ASH1L (468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 392.45Molecular Weight (Monoisotopic): 392.1170AlogP: 4.78#Rotatable Bonds: 6
Polar Surface Area: 51.18Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.68CX Basic pKa: CX LogP: 4.43CX LogD: 4.43
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: -0.91

References

1.  (2017)  Ash1l inhibitors and methods of treatment therewith, 

Source