4-{4-[(1R)-1-[(4-chloro-1,6-dimethyl-1H-indol-2-yl)formamido]ethyl]benzenesulfonyl}oxane-4-carboxylic acid

ID: ALA4548203

PubChem CID: 155553800

Max Phase: Preclinical

Molecular Formula: C25H27ClN2O6S

Molecular Weight: 519.02

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(Cl)c2cc(C(=O)N[C@H](C)c3ccc(S(=O)(=O)C4(C(=O)O)CCOCC4)cc3)n(C)c2c1

Standard InChI:  InChI=1S/C25H27ClN2O6S/c1-15-12-20(26)19-14-22(28(3)21(19)13-15)23(29)27-16(2)17-4-6-18(7-5-17)35(32,33)25(24(30)31)8-10-34-11-9-25/h4-7,12-14,16H,8-11H2,1-3H3,(H,27,29)(H,30,31)/t16-/m1/s1

Standard InChI Key:  NRMVQVYPBKOMJH-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   21.5689   -6.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3861   -6.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7924   -6.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3861   -5.4102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5689   -5.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1580   -6.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7476   -7.6478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7517   -6.8306    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.0419   -7.2356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3902   -4.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3891   -5.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0971   -5.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0953   -3.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8040   -4.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8088   -5.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5888   -5.3970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0661   -4.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5810   -4.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8833   -4.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2961   -5.4324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2877   -4.0170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1049   -4.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5093   -3.3020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5177   -4.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1103   -5.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5224   -6.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3405   -6.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7447   -5.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3303   -4.7106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8458   -6.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0929   -3.1075    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.6811   -5.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9846   -7.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8018   -7.5176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5832   -8.2377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  8  7  2  0
  9  8  2  0
 10 11  2  0
 11 12  1  0
 12 15  2  0
 14 13  2  0
 13 10  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 17 19  1  0
 19 20  2  0
 19 21  1  0
 22 21  1  6
 22 23  1  0
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27  8  1  0
  8  1  1  0
 16 30  1  0
 13 31  1  0
 11 32  1  0
  1 33  1  0
 33 34  1  0
 33 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4548203

    ---

Associated Targets(Human)

PHGDH Tchem D-3-phosphoglycerate dehydrogenase (883 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.02Molecular Weight (Monoisotopic): 518.1278AlogP: 4.04#Rotatable Bonds: 6
Polar Surface Area: 114.70Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.32CX Basic pKa: CX LogP: 3.51CX LogD: 0.09
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.51Np Likeness Score: -1.14

References

1.  (2018)  Tosylacetate based compounds and derivatives thereof as phgdh inhibitors, 

Source