(-)-3-Oxoelaeocarpine

ID: ALA4548238

PubChem CID: 155554295

Max Phase: Preclinical

Molecular Formula: C16H17NO3

Molecular Weight: 271.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc2c1C(=O)[C@@H]1[C@H](CCN3C(=O)CC[C@@H]13)O2

Standard InChI:  InChI=1S/C16H17NO3/c1-9-3-2-4-11-14(9)16(19)15-10-5-6-13(18)17(10)8-7-12(15)20-11/h2-4,10,12,15H,5-8H2,1H3/t10-,12-,15-/m0/s1

Standard InChI Key:  OOLVDTFZFJPPGR-WBIUFABUSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   11.6415   -3.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6403   -4.7156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3484   -5.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3466   -3.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0511   -3.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0545   -4.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7627   -5.1251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7560   -3.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4688   -3.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4698   -4.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1783   -5.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8904   -4.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1762   -3.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8841   -3.8898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4995   -3.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1679   -2.5945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3517   -2.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3442   -2.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7515   -2.6699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2939   -3.5191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4618   -5.5264    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.4618   -3.0748    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.1717   -4.2882    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  1  0
  9 13  1  0
 10 11  1  0
 11 12  1  0
 12 14  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  4 18  1  0
  8 19  2  0
 15 20  2  0
 10 21  1  1
  9 22  1  6
 13 23  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4548238

    ---

Associated Targets(Human)

BCHE Tclin Butyrylcholinesterase (7174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 271.32Molecular Weight (Monoisotopic): 271.1208AlogP: 1.95#Rotatable Bonds:
Polar Surface Area: 46.61Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.26CX LogD: 1.26
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.72Np Likeness Score: 1.25

References

1. Hong W, Zhang Y, Yang J, Xia MY, Luo JF, Li XN, Wang YH, Wang JS..  (2019)  Alkaloids from the Branches and Leaves of Elaeocarpus angustifolius.,  82  (12): [PMID:31736307] [10.1021/acs.jnatprod.8b01027]

Source