The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5-(Benzylamino)-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3-yl)(piperidin-1-yl)methanone ID: ALA4548328
PubChem CID: 155554287
Max Phase: Preclinical
Molecular Formula: C26H30N4O
Molecular Weight: 414.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1c2c(nn1-c1ccccc1)CCC(NCc1ccccc1)C2)N1CCCCC1
Standard InChI: InChI=1S/C26H30N4O/c31-26(29-16-8-3-9-17-29)25-23-18-21(27-19-20-10-4-1-5-11-20)14-15-24(23)28-30(25)22-12-6-2-7-13-22/h1-2,4-7,10-13,21,27H,3,8-9,14-19H2
Standard InChI Key: ONFVSJZWPOBFCT-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
16.8143 -18.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8143 -19.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5237 -20.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5237 -18.5849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0082 -20.0644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4890 -19.4059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0058 -18.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2290 -18.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2305 -19.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2610 -17.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0642 -17.7919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7090 -17.3528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6094 -18.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4094 -18.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6667 -17.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1175 -16.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3111 -17.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3030 -19.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7112 -20.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5276 -20.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9368 -19.4043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5236 -18.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7085 -18.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1059 -18.5902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3989 -19.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6905 -18.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6936 -17.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9861 -17.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2781 -17.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2821 -18.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9902 -19.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 9 1 0
8 4 1 0
8 9 1 0
6 7 1 0
5 6 1 0
7 8 2 0
9 5 2 0
7 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
11 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
6 18 1 0
1 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.55Molecular Weight (Monoisotopic): 414.2420AlogP: 4.15#Rotatable Bonds: 5Polar Surface Area: 50.16Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.07CX LogP: 4.12CX LogD: 2.45Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.68Np Likeness Score: -1.27
References 1. Iyamu ID, Lv W, Malik N, Mishra RK, Schiltz GE.. (2019) Discovery of a novel class of potent and selective tetrahydroindazole-based sigma-1 receptor ligands., 27 (9): [PMID:30904383 ] [10.1016/j.bmc.2019.03.030 ]