The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-{2-[(3R,5S)-1-Cyclopentylcarbamoyl-5-(pyridin-2-ylaminomethyl)-pyrrolidin-3-yloxy]-acetylamino}-2-(2,4,6-trimethyl-benzenesulfonylamino)-propionic acid ID: ALA4548360
PubChem CID: 11678980
Max Phase: Preclinical
Molecular Formula: C30H42N6O7S
Molecular Weight: 630.77
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c(S(=O)(=O)N[C@@H](CNC(=O)CO[C@@H]2C[C@@H](CNc3ccccn3)N(C(=O)NC3CCCC3)C2)C(=O)O)c(C)c1
Standard InChI: InChI=1S/C30H42N6O7S/c1-19-12-20(2)28(21(3)13-19)44(41,42)35-25(29(38)39)16-33-27(37)18-43-24-14-23(15-32-26-10-6-7-11-31-26)36(17-24)30(40)34-22-8-4-5-9-22/h6-7,10-13,22-25,35H,4-5,8-9,14-18H2,1-3H3,(H,31,32)(H,33,37)(H,34,40)(H,38,39)/t23-,24+,25-/m0/s1
Standard InChI Key: IHCPRNUOVTWPFZ-GVAUOCQISA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
12.2773 -6.0810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5665 -6.4841 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.2710 -6.8981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2801 -7.2507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7996 -7.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5084 -8.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6977 -8.7871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1802 -8.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3694 -8.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8481 -7.6517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0626 -7.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7950 -8.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9816 -8.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7490 -7.8900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4240 -7.4265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9684 -7.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3514 -8.1682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8050 -6.8222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0318 -6.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4234 -9.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6387 -9.0721 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0804 -9.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2858 -9.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7276 -10.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9768 -10.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7588 -11.0365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3210 -10.4397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4695 -7.3857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6104 -7.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1298 -8.3882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8984 -6.9873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0464 -5.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3324 -5.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8092 -4.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0001 -4.5851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7141 -5.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2372 -5.9888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9505 -6.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4776 -3.9557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1415 -4.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7875 -5.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9703 -5.7600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7052 -6.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3586 -7.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
5 4 1 6
6 5 1 0
7 6 1 0
8 7 1 0
9 8 1 0
10 9 1 0
11 10 1 6
12 11 1 0
13 12 1 0
14 13 1 0
14 15 1 0
11 15 1 0
14 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
13 20 1 1
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
8 28 2 0
5 29 1 0
29 30 2 0
29 31 1 0
2 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
32 37 2 0
37 38 1 0
35 39 1 0
33 40 1 0
19 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 19 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 630.77Molecular Weight (Monoisotopic): 630.2836AlogP: 2.08#Rotatable Bonds: 13Polar Surface Area: 179.06Molecular Species: ACIDHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.40CX Basic pKa: 6.63CX LogP: 0.32CX LogD: -0.48Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.22Np Likeness Score: -1.07
References 1. (2013) Compounds for the inhibition of angiogenesis and use thereof,