The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6-((4-tert-Butylbenzyl)(4-methoxyphenylsulfonyl)-aminomethyl)pyridin-2-ylamino)acetic Acid Hydrochloride ID: ALA4548451
PubChem CID: 70815427
Max Phase: Preclinical
Molecular Formula: C26H32ClN3O5S
Molecular Weight: 497.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(Cc2ccc(C(C)(C)C)cc2)Cc2cccc(NCC(=O)O)n2)cc1.Cl
Standard InChI: InChI=1S/C26H31N3O5S.ClH/c1-26(2,3)20-10-8-19(9-11-20)17-29(35(32,33)23-14-12-22(34-4)13-15-23)18-21-6-5-7-24(28-21)27-16-25(30)31;/h5-15H,16-18H2,1-4H3,(H,27,28)(H,30,31);1H
Standard InChI Key: QLTGIBRZYLREQV-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
46.4063 -26.5179 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
43.8708 -28.9083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.0458 -28.9083 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.4583 -29.6227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.9068 -29.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9057 -30.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6205 -30.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3369 -30.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3340 -29.3254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6187 -28.9163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0438 -28.0853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.7568 -27.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3279 -27.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3247 -26.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4728 -28.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0395 -26.4373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.6048 -25.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6112 -26.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4710 -28.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1862 -29.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9002 -28.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8944 -28.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1786 -27.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6167 -29.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6209 -30.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.3291 -28.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.3291 -29.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3201 -25.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0336 -25.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7459 -25.1942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.4626 -25.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1748 -25.1864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8915 -25.5950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.1703 -24.3614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1908 -30.5684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4768 -30.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 3 1 0
3 11 1 0
11 12 1 0
11 13 1 0
13 14 1 0
12 15 1 0
14 16 2 0
16 29 1 0
28 17 1 0
17 18 2 0
18 14 1 0
15 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 15 1 0
21 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
32 34 1 0
6 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.62Molecular Weight (Monoisotopic): 497.1984AlogP: 4.28#Rotatable Bonds: 10Polar Surface Area: 108.83Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.12CX Basic pKa: 5.67CX LogP: 2.28CX LogD: 0.95Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -1.42
References 1. Iwamura R, Tanaka M, Okanari E, Kirihara T, Odani-Kawabata N, Shams N, Yoneda K.. (2018) Identification of a Selective, Non-Prostanoid EP2 Receptor Agonist for the Treatment of Glaucoma: Omidenepag and its Prodrug Omidenepag Isopropyl., 61 (15): [PMID:29995405 ] [10.1021/acs.jmedchem.8b00808 ]