(6-((4-tert-Butylbenzyl)(4-methoxyphenylsulfonyl)-aminomethyl)pyridin-2-ylamino)acetic Acid Hydrochloride

ID: ALA4548451

PubChem CID: 70815427

Max Phase: Preclinical

Molecular Formula: C26H32ClN3O5S

Molecular Weight: 497.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N(Cc2ccc(C(C)(C)C)cc2)Cc2cccc(NCC(=O)O)n2)cc1.Cl

Standard InChI:  InChI=1S/C26H31N3O5S.ClH/c1-26(2,3)20-10-8-19(9-11-20)17-29(35(32,33)23-14-12-22(34-4)13-15-23)18-21-6-5-7-24(28-21)27-16-25(30)31;/h5-15H,16-18H2,1-4H3,(H,27,28)(H,30,31);1H

Standard InChI Key:  QLTGIBRZYLREQV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
   46.4063  -26.5179    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   43.8708  -28.9083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.0458  -28.9083    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   43.4583  -29.6227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.9068  -29.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9057  -30.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6205  -30.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3369  -30.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3340  -29.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6187  -28.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0438  -28.0853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.7568  -27.6701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3279  -27.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3247  -26.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4728  -28.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0395  -26.4373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.6048  -25.6220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6112  -26.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4710  -28.9052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1862  -29.3149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.9002  -28.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8944  -28.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1786  -27.6644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6167  -29.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6209  -30.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.3291  -28.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.3291  -29.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3201  -25.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0336  -25.6107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7459  -25.1942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.4626  -25.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1748  -25.1864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8915  -25.5950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.1703  -24.3614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1908  -30.5684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4768  -30.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9  3  1  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 12 15  1  0
 14 16  2  0
 16 29  1  0
 28 17  1  0
 17 18  2  0
 18 14  1  0
 15 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 15  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
  6 35  1  0
 35 36  1  0
M  END

Associated Targets(Human)

PTGER2 Tclin Prostanoid EP2 receptor (1730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.62Molecular Weight (Monoisotopic): 497.1984AlogP: 4.28#Rotatable Bonds: 10
Polar Surface Area: 108.83Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.12CX Basic pKa: 5.67CX LogP: 2.28CX LogD: 0.95
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -1.42

References

1. Iwamura R, Tanaka M, Okanari E, Kirihara T, Odani-Kawabata N, Shams N, Yoneda K..  (2018)  Identification of a Selective, Non-Prostanoid EP2 Receptor Agonist for the Treatment of Glaucoma: Omidenepag and its Prodrug Omidenepag Isopropyl.,  61  (15): [PMID:29995405] [10.1021/acs.jmedchem.8b00808]

Source