Ethyl (4R,4aS,6aR,9S,11aR,11bS,E)-8-(((2-chlorothiazol-5-yl)methoxy)imino)-4,9,11b-trimethyltetradecahydro-6a,9-methanocyclohepta[a]naphthalene-4-carboxylate

ID: ALA4548476

PubChem CID: 155545465

Max Phase: Preclinical

Molecular Formula: C26H37ClN2O3S

Molecular Weight: 493.11

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)C/C4=N\OCc1cnc(Cl)s1

Standard InChI:  InChI=1S/C26H37ClN2O3S/c1-5-31-21(30)25(4)10-6-9-24(3)18(25)8-12-26-13-20(23(2,16-26)11-7-19(24)26)29-32-15-17-14-28-22(27)33-17/h14,18-19H,5-13,15-16H2,1-4H3/b29-20+/t18-,19-,23-,24+,25+,26-/m0/s1

Standard InChI Key:  CSIPUFSNTCRCFA-NXLHDXIISA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   20.1290  -27.4637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7328  -26.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3320  -27.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5314  -27.4585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1288  -28.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3281  -28.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7301  -28.1578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0476  -26.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0476  -25.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7364  -25.1731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4293  -25.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4258  -26.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1155  -26.7793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8090  -26.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8125  -25.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1183  -25.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1237  -24.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8294  -23.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5236  -24.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5121  -25.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2120  -24.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5021  -25.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0024  -24.5775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5774  -25.1582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3678  -24.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9427  -25.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8149  -26.3355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5412  -26.7100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1219  -26.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7544  -25.4052    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.0882  -23.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1154  -25.9779    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.4179  -27.1748    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.4220  -24.7728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9284  -26.2668    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  6
  3  4  1  0
  4  5  1  0
  5  6  1  0
  3  7  2  0
  8  2  1  0
  9  8  1  0
  9 10  1  0
 11 10  1  0
 11 12  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 11 16  1  0
 16 17  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 15 20  1  0
 19 21  1  0
 22 21  1  0
 15 22  1  6
 21 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  1  0
 19 31  1  1
 16 32  1  1
 12 33  1  1
 11 34  1  6
 29 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548476

    ---

Associated Targets(Human)

F10 Tclin Coagulation factor X (9693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.11Molecular Weight (Monoisotopic): 492.2213AlogP: 7.04#Rotatable Bonds: 5
Polar Surface Area: 60.78Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.18CX LogP: 6.82CX LogD: 6.82
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: 1.31

References

1. Chen P, Zhang D, Li M, Wu Q, Lam YPY, Guo Y, Chen C, Bai N, Malhotra S, Li W, O'Connor PB, Fu H..  (2019)  Discovery of novel, potent, isosteviol-based antithrombotic agents.,  183  [PMID:31563807] [10.1016/j.ejmech.2019.111722]

Source