3-methoxy-4-(5-(4-(5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl)phenyl)-1,3,4-oxadiazol-2-yl)phenol

ID: ALA4548549

PubChem CID: 155545473

Max Phase: Preclinical

Molecular Formula: C22H15N5O3S

Molecular Weight: 429.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)ccc1-c1nnc(-c2ccc(-c3nnc(-c4ccncc4)s3)cc2)o1

Standard InChI:  InChI=1S/C22H15N5O3S/c1-29-18-12-16(28)6-7-17(18)20-25-24-19(30-20)13-2-4-14(5-3-13)21-26-27-22(31-21)15-8-10-23-11-9-15/h2-12,28H,1H3

Standard InChI Key:  QVJLFSJTUCTTGO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   31.1715   -9.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1704  -10.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8784  -10.7541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5881  -10.3447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5853   -9.5220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8767   -9.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4624  -10.7532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8742   -8.2996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1653   -7.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2892   -9.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0370   -9.4419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5815   -8.8326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.1702   -8.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3138   -8.2994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4967   -7.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3103   -7.2932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6398   -6.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1568   -5.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3405   -5.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0147   -6.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4816   -5.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3090   -4.9652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3613   -4.1521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6130   -3.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0694   -4.4048    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.4485   -3.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0605   -2.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8966   -1.6831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1204   -1.4246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5080   -1.9720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6751   -2.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  6  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  5 10  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 18 21  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548549

    ---

Associated Targets(Human)

GUSB Tchem Beta-glucuronidase (537 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.46Molecular Weight (Monoisotopic): 429.0896AlogP: 4.70#Rotatable Bonds: 5
Polar Surface Area: 107.05Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.53CX Basic pKa: 3.03CX LogP: 3.15CX LogD: 3.12
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -0.61

References

1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA..  (2019)  Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study.,  27  (14): [PMID:31196753] [10.1016/j.bmc.2019.05.049]

Source