The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-Phenyldecyl 2,3-dihydroxybenzoate ID: ALA4548589
PubChem CID: 155549279
Max Phase: Preclinical
Molecular Formula: C23H30O4
Molecular Weight: 370.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(OCCCCCCCCCCc1ccccc1)c1cccc(O)c1O
Standard InChI: InChI=1S/C23H30O4/c24-21-17-12-16-20(22(21)25)23(26)27-18-11-6-4-2-1-3-5-8-13-19-14-9-7-10-15-19/h7,9-10,12,14-17,24-25H,1-6,8,11,13,18H2
Standard InChI Key: RPCGXJZJXAVHLK-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
1.6082 -21.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6071 -22.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3151 -22.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0248 -22.0949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0219 -21.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3133 -20.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9004 -20.8674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3109 -20.0498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7281 -20.8610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4373 -21.2669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7250 -20.0438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1435 -20.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8527 -21.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5589 -20.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2682 -21.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9743 -20.8450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6836 -21.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3897 -20.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0990 -21.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8051 -20.8343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5144 -21.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2205 -20.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9269 -21.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6325 -20.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6299 -20.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9157 -19.6018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2129 -20.0147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
6 8 1 0
5 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 370.49Molecular Weight (Monoisotopic): 370.2144AlogP: 5.62#Rotatable Bonds: 12Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.27CX Basic pKa: ┄CX LogP: 7.59CX LogD: 7.58Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.29Np Likeness Score: 0.12
References 1. Wang Z, Ma C, Wang Y, Xiao Q, Xu C, Li Y.. (2019) Structural optimization and neurotrophic activity evaluation of neurotrophic gentiside derivatives., 29 (22): [PMID:31607606 ] [10.1016/j.bmcl.2019.126685 ]