(3S,8S,9S,10R,13R,14S,17R)-17-((S)-5-Hydroxy-5-methylhexan-2-yl)-3,10,13-trimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol

ID: ALA4548602

PubChem CID: 155549359

Max Phase: Preclinical

Molecular Formula: C27H46O2

Molecular Weight: 402.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](CCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C27H46O2/c1-18(11-13-24(2,3)28)21-9-10-22-20-8-7-19-17-25(4,29)15-16-26(19,5)23(20)12-14-27(21,22)6/h7,18,20-23,28-29H,8-17H2,1-6H3/t18-,20-,21+,22-,23-,25-,26-,27+/m0/s1

Standard InChI Key:  GLXBRGHIMATFKV-ACEZCWTCSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    1.8490  -15.4235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2617  -14.7136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4400  -14.7090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7167  -11.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8070  -12.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6815  -13.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6815  -14.7136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8070  -13.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3914  -13.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1013  -13.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5912  -12.4064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3914  -15.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1013  -12.2496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1013  -14.7136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3914  -12.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5912  -13.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9716  -13.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0782  -13.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9716  -15.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8070  -11.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2617  -13.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6815  -13.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1013  -13.0709    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8070  -14.3050    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3914  -14.3050    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5871  -11.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2968  -11.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0107  -11.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7113  -10.3470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4271  -11.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4225  -10.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2969  -11.9937    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8778  -11.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  1
  6  9  1  0
  7  6  1  0
  8  5  1  0
  9 15  1  0
 10  8  1  0
 11  5  1  0
 12 14  1  0
 13  5  1  0
 14 10  1  0
 15 13  1  0
 16  8  1  0
 17  6  1  0
 18 11  1  0
 19  7  1  0
  5 20  1  1
 21 17  1  0
  2 21  1  0
  6 22  1  1
 10 23  1  1
  8 24  1  6
  9 25  1  6
 16 18  1  0
 10  9  1  0
  7 12  2  0
 19  2  1  0
 11 26  1  0
 26 27  1  0
 27 28  1  0
 28  4  1  0
  4 29  1  0
  4 30  1  0
  4 31  1  0
 11 32  1  6
 26 33  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4548602

    ---

Associated Targets(Human)

GRIN1 Tclin Glutamate NMDA receptor; GRIN1/GRIN2B (726 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GRIN1 Tclin Glutamate NMDA receptor; GRIN1/GRIN2A (719 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.66Molecular Weight (Monoisotopic): 402.3498AlogP: 6.50#Rotatable Bonds: 4
Polar Surface Area: 40.46Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.48CX LogD: 5.48
Aromatic Rings: Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: 2.57

References

1. La DS, Salituro FG, Martinez Botella G, Griffin AM, Bai Z, Ackley MA, Dai J, Doherty JJ, Harrison BL, Hoffmann EC, Kazdoba TM, Lewis MC, Quirk MC, Robichaud AJ..  (2019)  Neuroactive Steroid N-Methyl-d-aspartate Receptor Positive Allosteric Modulators: Synthesis, SAR, and Pharmacological Activity.,  62  (16): [PMID:31390523] [10.1021/acs.jmedchem.9b00591]

Source