(3S,6S,9S,12S,15S,18S,21S,24S,27S)-27-acetamido-18-sec-butyl-3-carbamoyl-12-(carboxymethyl)-21-((R)-1-hydroxyethyl)-24-(hydroxymethyl)-6-isobutyl-9-isopropyl-5,8,11,14,17,20,23,26-octaoxo-15-((2-oxo-7-(phosphonooxy)-2H-chromen-4-yl)methyl)-4,7,10,13,16,19,22,25-octaazanonacosane-1,29-dioic acid

ID: ALA4548611

PubChem CID: 155549400

Max Phase: Preclinical

Molecular Formula: C50H73N10O24P

Molecular Weight: 1229.15

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Bioactivity Summary Target Summary Assay Summary

Names and Identifiers

Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CC(=O)O)NC(C)=O)[C@@H](C)O)C(=O)N[C@@H](Cc1cc(=O)oc2cc(OP(=O)(O)O)ccc12)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(N)=O)C(C)C

Standard InChI: InChI=1S/C50H73N10O24P/c1-9-22(6)40(59-50(79)41(23(7)62)60-47(76)33(19-61)57-45(74)31(17-36(66)67)52-24(8)63)49(78)56-30(13-25-14-38(70)83-34-15-26(10-11-27(25)34)84-85(80,81)82)44(73)54-32(18-37(68)69)46(75)58-39(21(4)5)48(77)55-29(12-20(2)3)43(72)53-28(42(51)71)16-35(64)65/h10-11,14-15,20-23,28-33,39-41,61-62H,9,12-13,16-19H2,1-8H3,(H2,51,71)(H,52,63)(H,53,72)(H,54,73)(H,55,77)(H,56,78)(H,57,74)(H,58,75)(H,59,79)(H,60,76)(H,64,65)(H,66,67)(H,68,69)(H2,80,81,82)/t22-,23+,28-,29-,30-,31-,32-,33-,39-,40-,41-/m0/s1

Standard InChI Key: WGKSNFBRKMUBQT-AUYKUYRXSA-N

Molfile:

 
     RDKit          2D

 85 86  0  0  0  0  0  0  0  0999 V2000
   41.2393  -25.6961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.8348  -24.9904    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   40.4258  -25.6935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0115  -28.0765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0244  -27.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4466  -27.2755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7419  -26.8548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3238  -26.8326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3367  -26.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0500  -25.6150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6320  -25.5927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7547  -26.0357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4723  -25.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1600  -26.8770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1728  -26.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4851  -24.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8903  -25.6595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5950  -26.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3213  -24.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3084  -25.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5822  -26.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2828  -27.3200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8647  -27.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0131  -26.1024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7265  -25.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4184  -26.9438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4312  -26.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7394  -24.8847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0388  -24.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4569  -24.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4697  -23.6671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1487  -25.7262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8493  -26.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5412  -27.3867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8365  -26.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5668  -25.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1231  -27.3645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1102  -28.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5283  -28.2100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8107  -28.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7979  -29.4276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5026  -29.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2330  -28.6307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2201  -29.4498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4898  -30.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1945  -31.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7722  -31.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9207  -29.8705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.6382  -29.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3301  -30.7119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3429  -29.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6510  -28.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3686  -28.2545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0691  -28.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3815  -27.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0563  -29.4943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.7610  -29.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0306  -31.1326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.7482  -30.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4785  -29.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1791  -29.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1662  -30.7563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8966  -29.5388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.4528  -31.1548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2981  -28.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5934  -28.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2853  -29.2942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9592  -27.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6768  -27.0105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9849  -25.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6896  -26.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4071  -25.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4200  -24.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7153  -24.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9977  -24.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1334  -24.5752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9464  -28.2322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2582  -26.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2715  -26.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5486  -24.5953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3959  -28.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6950  -28.1645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7084  -27.3474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9806  -28.5615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7839  -24.3985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  7 12  1  0
 15 17  1  0
 20 24  1  0
 27 32  1  0
 35 37  1  0
 40 41  1  0
 44 48  1  0
 51 56  1  0
 59 64  1  0
  5  4  1  1
  5  7  1  0
  7  6  2  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 13 12  1  1
 13 15  1  0
 15 14  2  0
 13 16  1  0
 18 17  1  6
 18 20  1  0
 20 19  2  0
 18 21  1  0
 21 22  1  6
 21 23  1  0
 25 24  1  1
 25 27  1  0
 27 26  2  0
 25 28  1  0
 28 29  1  1
 28 30  1  0
 30 31  1  0
 32 33  1  0
 33 35  1  0
 35 34  2  0
 33 36  1  1
 38 37  1  6
 38 40  1  0
 40 39  2  0
 42 41  1  6
 42 44  1  0
 44 43  2  0
 42 45  1  0
 45 46  1  0
 45 47  1  0
 49 48  1  1
 49 51  1  0
 51 50  2  0
 49 52  1  0
 52 53  1  0
 53 54  1  0
 53 55  1  0
 57 56  1  0
 57 59  1  0
 59 58  2  0
 57 60  1  1
 60 61  1  0
 61 62  2  0
 61 63  1  0
  4 65  1  0
 65 66  1  0
 65 67  2  0
 36 79  1  0
 79 70  1  0
 68 69  1  0
 69 71  1  0
 70 71  2  0
 71 72  1  0
 72 73  2  0
 73 74  1  0
 74 75  2  0
 75 70  1  0
 73 76  1  0
 68 77  2  0
 68 78  1  0
 78 79  2  0
 76  2  1  0
  2 80  2  0
 38 81  1  0
 81 82  1  0
 82 83  2  0
 82 84  1  0
 16 85  1  0
M  END

Associated Targets(Human)

PTPN11 Tchem Protein-tyrosine phosphatase 2C (2297 Activities)

Discover Target: PTPN11

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

PTPRM Tchem Receptor-type tyrosine-protein phosphatase mu (41 Activities)

Discover Target: PTPRM

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Unknown	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1229.15	Molecular Weight (Monoisotopic): 1228.4537	AlogP: ┄	#Rotatable Bonds: ┄
Polar Surface Area: ┄	Molecular Species: ┄	HBA: ┄	HBD: ┄
#RO5 Violations: ┄	HBA (Lipinski): ┄	HBD (Lipinski): ┄	#RO5 Violations (Lipinski): ┄
CX Acidic pKa: ┄	CX Basic pKa: ┄	CX LogP: ┄	CX LogD: ┄
Aromatic Rings: ┄	Heavy Atoms: ┄	QED Weighted: ┄	Np Likeness Score: ┄

References

1. Ma ES, Barrios AM.. (2019) Rational design of a SHP-2 targeted, fluorogenic peptide substrate., 29 (17): [PMID:31351693] [10.1016/j.bmcl.2019.07.034]
2. Lawrence, Harshani R and 10 more authors. 2008-08-28 Inhibitors of Src homology-2 domain containing protein tyrosine phosphatase-2 (Shp2) based on oxindole scaffolds. [PMID:18680359]
3. Geronikaki, A A and 5 more authors. 2008-09-11 2-Thiazolylimino/heteroarylimino-5-arylidene-4-thiazolidinones as new agents with SHP-2 inhibitory action. [PMID:18702480]
4. Dawson, Marcia I MI and 21 more authors. 2008-09-25 Adamantyl-substituted retinoid-derived molecules that interact with the orphan nuclear receptor small heterodimer partner: effects of replacing the 1-adamantyl or hydroxyl group on inhibition of cancer cell growth, induction of cancer cell apoptosis, and inhibition of SRC homology 2 domain-containing protein tyrosine phosphatase-2 activity. [PMID:18759424]
5. He, Yantao and 6 more authors. 2013-02-14 Discovery and evaluation of novel inhibitors of mycobacterium protein tyrosine phosphatase B from the 6-Hydroxy-benzofuran-5-carboxylic acid scaffold. [PMID:23305444]
6. He, Yantao Y and 11 more authors. 2013-06-27 A potent and selective small-molecule inhibitor for the lymphoid-specific tyrosine phosphatase (LYP), a target associated with autoimmune diseases. [PMID:23713581]
7. Zeng, Li-Fan LF and 12 more authors. 2014-08-14 Therapeutic potential of targeting the oncogenic SHP2 phosphatase. [PMID:25003231]
8. Tautz, Lutz L, Senis, Yotis A YA, Oury, Cécile C and Rahmouni, Souad S. 2015-06-15 Perspective: Tyrosine phosphatases as novel targets for antiplatelet therapy. [PMID:25921264]
9. Sun, Wenlong W and 6 more authors. 2017-08-01 Varic acid analogues from fungus as PTP1B inhibitors: Biological evaluation and structure-activity relationships. [PMID:28642102]
10. Xie, Jingjing J and 10 more authors. 2017-12-28 Allosteric Inhibitors of SHP2 with Therapeutic Potential for Cancer Treatment. [PMID:29155585]
11. Du, Yongli Y, Zhang, Yanhui Y, Ling, Hao H, Li, Qunyi Q and Shen, Jingkang J. 2018-01-20 Discovery of novel high potent and cellular active ADC type PTP1B inhibitors with selectivity over TC-PTP via modification interacting with C site. [PMID:29289892]
12. Kim, Bohee and 6 more authors. 2020-01-01 Development and structure-activity relationship study of SHP2 inhibitor containing 3,4,6-trihydroxy-5-oxo-5H-benzo[7]annulene. [PMID:31784318]
13. Wang, Mingliang; Lu, Jianfeng; Wang, Mi; Yang, Chao-Yie and Wang, Shaomeng. 2020-07-23 Discovery of SHP2-D26 as a First, Potent, and Effective PROTAC Degrader of SHP2 Protein. [PMID:32437146]
14. Yuan, Xinrui; Bu, Hong; Zhou, Jinpei; Yang, Chao-Yie and Zhang, Huibin. 2020-10-22 Recent Advances of SHP2 Inhibitors in Cancer Therapy: Current Development and Clinical Application. [PMID:32460492]

(3S,6S,9S,12S,15S,18S,21S,24S,27S)-27-acetamido-18-sec-butyl-3-carbamoyl-12-(carboxymethyl)-21-((R)-1-hydroxyethyl)-24-(hydroxymethyl)-6-isobutyl-9-isopropyl-5,8,11,14,17,20,23,26-octaoxo-15-((2-oxo-7-(phosphonooxy)-2H-chromen-4-yl)methyl)-4,7,10,13,16,19,22,25-octaazanonacosane-1,29-dioic acid

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source