The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(benzylamino)-2-oxo-1-phenylethyl)-N-(2,3-dimethylphenyl)-2,4-dimethylthiazole-5-carboxamide ID: ALA4548627
PubChem CID: 155549435
Max Phase: Preclinical
Molecular Formula: C29H29N3O2S
Molecular Weight: 483.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(C)c(C(=O)N(c2cccc(C)c2C)C(C(=O)NCc2ccccc2)c2ccccc2)s1
Standard InChI: InChI=1S/C29H29N3O2S/c1-19-12-11-17-25(20(19)2)32(29(34)27-21(3)31-22(4)35-27)26(24-15-9-6-10-16-24)28(33)30-18-23-13-7-5-8-14-23/h5-17,26H,18H2,1-4H3,(H,30,33)
Standard InChI Key: AYPCBIGIAQQXMB-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
11.2895 -5.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0479 -5.6407 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.0425 -4.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2773 -4.5974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8140 -5.2472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8126 -4.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5079 -4.4368 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1214 -4.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4261 -4.8371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7349 -4.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7349 -3.6361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4261 -6.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8126 -5.6419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2033 -4.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1214 -3.6361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8160 -3.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8164 -2.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1246 -2.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4269 -2.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4301 -3.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7325 -6.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7321 -7.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4239 -7.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1215 -7.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1184 -6.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0208 -3.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0471 -6.6587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8124 -6.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8142 -7.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2033 -5.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5058 -6.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5054 -6.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2013 -7.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8948 -6.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8917 -6.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 8 1 0
8 9 1 0
9 10 1 0
10 3 1 0
10 11 2 0
9 12 1 0
6 13 2 0
7 14 1 0
8 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
12 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 12 1 0
4 26 1 0
1 27 1 0
25 28 1 0
24 29 1 0
14 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.64Molecular Weight (Monoisotopic): 483.1980AlogP: 6.08#Rotatable Bonds: 7Polar Surface Area: 62.30Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.90CX Basic pKa: 1.55CX LogP: 5.56CX LogD: 5.56Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.70
References 1. Makane VB, Krishna VS, Krishna EV, Shukla M, Mahizhaveni B, Misra S, Chopra S, Sriram D, Dusthackeer VNA, Rode HB.. (2019) Synthesis and evaluation of α-aminoacyl amides as antitubercular agents effective on drug resistant tuberculosis., 164 [PMID:30654238 ] [10.1016/j.ejmech.2019.01.002 ]