The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl ((S)-1-(((S)-4-(benzylamino)-1-(naphthalen-1-yl)-3,4-dioxobutan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate ID: ALA4548647
PubChem CID: 155548878
Max Phase: Preclinical
Molecular Formula: C34H35N3O5
Molecular Weight: 565.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](C(=O)C(=O)NCc1ccccc1)c1cccc2ccccc12
Standard InChI: InChI=1S/C34H35N3O5/c1-23(2)20-29(36-34(41)42-22-25-14-7-4-8-15-25)32(39)37-30(28-19-11-17-26-16-9-10-18-27(26)28)31(38)33(40)35-21-24-12-5-3-6-13-24/h3-19,23,29-30H,20-22H2,1-2H3,(H,35,40)(H,36,41)(H,37,39)/t29-,30-/m0/s1
Standard InChI Key: JGQVPAZGBDAPMS-KYJUHHDHSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
33.8294 -18.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5439 -18.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1149 -18.4085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8294 -19.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1149 -17.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4005 -17.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4034 -16.3449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6898 -15.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9744 -16.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9770 -17.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6912 -17.5829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2575 -18.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9728 -18.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3110 -19.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6873 -18.8210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.9728 -17.5834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4017 -18.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1162 -18.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8307 -18.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5451 -18.8210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3558 -17.7126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2596 -18.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9742 -18.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9725 -19.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6861 -20.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4016 -19.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3989 -18.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6847 -18.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0550 -19.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1338 -20.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7268 -19.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1162 -19.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4017 -17.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4047 -15.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6878 -16.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6910 -17.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1196 -16.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1185 -17.1733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8299 -17.5841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5428 -17.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5400 -16.3463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8281 -15.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
2 12 1 0
12 13 1 0
12 14 1 6
13 15 1 0
13 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
14 29 1 0
29 30 1 0
29 31 1 0
18 32 2 0
17 33 1 1
33 38 2 0
37 34 2 0
34 35 1 0
35 36 2 0
36 33 1 0
37 38 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.67Molecular Weight (Monoisotopic): 565.2577AlogP: 5.22#Rotatable Bonds: 12Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.98CX Basic pKa: ┄CX LogP: 6.09CX LogD: 6.09Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.20Np Likeness Score: -0.51
References 1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M.. (2019) Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors., 10 (7): [PMID:31312413 ] [10.1021/acsmedchemlett.9b00233 ]