(2S)-2-methoxypropyl 2-{4-[(1R)-1-[(4-chloro-1,6-dimethyl-1H-indol-2-yl)formamido]ethyl]benzenesulfonyl}acetate

ID: ALA4548661

PubChem CID: 142427758

Max Phase: Preclinical

Molecular Formula: C25H29ClN2O6S

Molecular Weight: 521.04

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO[C@@H](C)COC(=O)CS(=O)(=O)c1ccc([C@@H](C)NC(=O)c2cc3c(Cl)cc(C)cc3n2C)cc1

Standard InChI:  InChI=1S/C25H29ClN2O6S/c1-15-10-21(26)20-12-23(28(4)22(20)11-15)25(30)27-17(3)18-6-8-19(9-7-18)35(31,32)14-24(29)34-13-16(2)33-5/h6-12,16-17H,13-14H2,1-5H3,(H,27,30)/t16-,17+/m0/s1

Standard InChI Key:  BWHRFJBAGWUHEX-DLBZAZTESA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   22.3737   -5.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5524   -6.4426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5565   -5.6254    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.8467   -6.0304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1950   -3.1284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1939   -3.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9019   -4.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9001   -2.7195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6088   -3.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6136   -3.9434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3936   -4.1919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8710   -3.5267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3858   -2.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6881   -3.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1009   -4.2272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0926   -2.8118    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9097   -2.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3141   -2.0969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3225   -3.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9151   -4.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3272   -4.9267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1453   -4.9224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5495   -4.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1351   -3.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6506   -4.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8977   -1.9024    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.4859   -4.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7894   -6.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6066   -6.3124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3880   -7.0325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0223   -7.0160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8395   -7.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2552   -7.7113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2409   -6.2959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0580   -6.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  2  0
 14 16  1  0
 17 16  1  6
 17 18  1  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22  3  1  0
  3  1  1  0
 11 25  1  0
  8 26  1  0
  6 27  1  0
  1 28  1  0
 28 29  1  0
 28 30  2  0
 29 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  1
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548661

    ---

Associated Targets(Human)

PHGDH Tchem D-3-phosphoglycerate dehydrogenase (883 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.04Molecular Weight (Monoisotopic): 520.1435AlogP: 3.98#Rotatable Bonds: 9
Polar Surface Area: 103.70Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.73CX Basic pKa: CX LogP: 3.84CX LogD: 3.84
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -1.27

References

1.  (2018)  Tosylacetate based compounds and derivatives thereof as phgdh inhibitors, 

Source