The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,4-difluoro-N-(2-methoxy-5-(4-methyl-8-(2-(pyrrolidin-1-yl)ethoxy)quinazolin-6-yl)pyridin-3-yl)benzenesulfonamide ID: ALA4548696
PubChem CID: 135197618
Max Phase: Preclinical
Molecular Formula: C27H27F2N5O4S
Molecular Weight: 555.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncc(-c2cc(OCCN3CCCC3)c3ncnc(C)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F
Standard InChI: InChI=1S/C27H27F2N5O4S/c1-17-21-11-18(13-24(26(21)32-16-31-17)38-10-9-34-7-3-4-8-34)19-12-23(27(37-2)30-15-19)33-39(35,36)25-6-5-20(28)14-22(25)29/h5-6,11-16,33H,3-4,7-10H2,1-2H3
Standard InChI Key: CWUWUTZYVVHSIQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
20.6609 -13.3763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0736 -14.0862 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.4820 -13.3739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8347 -15.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5444 -15.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5415 -14.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8329 -14.1024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1266 -15.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1289 -14.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4230 -14.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7143 -14.5116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7160 -15.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4225 -15.7378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8345 -16.5570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4243 -13.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2447 -14.0977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9542 -14.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6599 -14.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6572 -13.2767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9430 -12.8710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2403 -13.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3689 -14.5011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7843 -14.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7834 -15.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4917 -15.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1990 -15.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1937 -14.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4849 -14.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3629 -12.8645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3587 -12.0474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0761 -15.7223 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.9086 -15.7136 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.5421 -16.9658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5419 -17.7830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2495 -18.1917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3377 -19.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1370 -19.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5458 -18.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9990 -17.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
4 14 1 0
10 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
6 16 1 0
18 22 1 0
22 2 1 0
2 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
19 29 1 0
29 30 1 0
24 31 1 0
26 32 1 0
14 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.61Molecular Weight (Monoisotopic): 555.1752AlogP: 4.56#Rotatable Bonds: 9Polar Surface Area: 106.54Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.58CX Basic pKa: 9.05CX LogP: 2.18CX LogD: 2.10Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.32Np Likeness Score: -1.73
References 1. Lin S, Jin J, Liu Y, Tian H, Zhang Y, Fu R, Zhang J, Wang M, Du T, Ji M, Wu D, Zhang K, Sheng L, Li Y, Chen X, Xu H.. (2019) Discovery of 4-Methylquinazoline Based PI3K Inhibitors for the Potential Treatment of Idiopathic Pulmonary Fibrosis., 62 (19): [PMID:31335136 ] [10.1021/acs.jmedchem.9b00969 ]