2,4-difluoro-N-(2-methoxy-5-(4-methyl-8-(2-(pyrrolidin-1-yl)ethoxy)quinazolin-6-yl)pyridin-3-yl)benzenesulfonamide

ID: ALA4548696

PubChem CID: 135197618

Max Phase: Preclinical

Molecular Formula: C27H27F2N5O4S

Molecular Weight: 555.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ncc(-c2cc(OCCN3CCCC3)c3ncnc(C)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F

Standard InChI:  InChI=1S/C27H27F2N5O4S/c1-17-21-11-18(13-24(26(21)32-16-31-17)38-10-9-34-7-3-4-8-34)19-12-23(27(37-2)30-15-19)33-39(35,36)25-6-5-20(28)14-22(25)29/h5-6,11-16,33H,3-4,7-10H2,1-2H3

Standard InChI Key:  CWUWUTZYVVHSIQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   20.6609  -13.3763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0736  -14.0862    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.4820  -13.3739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8347  -15.7398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5444  -15.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5415  -14.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8329  -14.1024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1266  -15.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1289  -14.5131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4230  -14.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7143  -14.5116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7160  -15.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4225  -15.7378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8345  -16.5570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4243  -13.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2447  -14.0977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9542  -14.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6599  -14.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6572  -13.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9430  -12.8710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2403  -13.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3689  -14.5011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7843  -14.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7834  -15.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4917  -15.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1990  -15.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1937  -14.4869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4849  -14.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3629  -12.8645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3587  -12.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0761  -15.7223    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.9086  -15.7136    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.5421  -16.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5419  -17.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2495  -18.1917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3377  -19.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1370  -19.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5458  -18.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9990  -17.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  8  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
  4 14  1  0
 10 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  6 16  1  0
 18 22  1  0
 22  2  1  0
  2 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 19 29  1  0
 29 30  1  0
 24 31  1  0
 26 32  1  0
 14 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548696

    ---

Associated Targets(Human)

PIK3R1 Tchem PI3-kinase p110-alpha/p85-alpha (2589 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.61Molecular Weight (Monoisotopic): 555.1752AlogP: 4.56#Rotatable Bonds: 9
Polar Surface Area: 106.54Molecular Species: BASEHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.58CX Basic pKa: 9.05CX LogP: 2.18CX LogD: 2.10
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.32Np Likeness Score: -1.73

References

1. Lin S, Jin J, Liu Y, Tian H, Zhang Y, Fu R, Zhang J, Wang M, Du T, Ji M, Wu D, Zhang K, Sheng L, Li Y, Chen X, Xu H..  (2019)  Discovery of 4-Methylquinazoline Based PI3K Inhibitors for the Potential Treatment of Idiopathic Pulmonary Fibrosis.,  62  (19): [PMID:31335136] [10.1021/acs.jmedchem.9b00969]

Source