The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N4-tert-butyl-N1-(2-(2-fluorobenzamido)ethyl)-2-(5-methylisoxazole-3-sulfonamido)succinamide ID: ALA4548705
PubChem CID: 155549227
Max Phase: Preclinical
Molecular Formula: C21H28FN5O6S
Molecular Weight: 497.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(S(=O)(=O)N[C@@H](CC(=O)NC(C)(C)C)C(=O)NCCNC(=O)c2ccccc2F)no1
Standard InChI: InChI=1S/C21H28FN5O6S/c1-13-11-18(26-33-13)34(31,32)27-16(12-17(28)25-21(2,3)4)20(30)24-10-9-23-19(29)14-7-5-6-8-15(14)22/h5-8,11,16,27H,9-10,12H2,1-4H3,(H,23,29)(H,24,30)(H,25,28)/t16-/m0/s1
Standard InChI Key: GQWNRFHXIIMDAV-INIZCTEOSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
32.0892 -10.9041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6847 -10.1984 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.2758 -10.9015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1004 -10.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8081 -9.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5158 -10.1984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8081 -8.9726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3927 -9.7898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1004 -11.0156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9772 -9.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8081 -11.4242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8081 -12.2414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5158 -11.0156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5158 -12.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5158 -13.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2235 -12.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2176 -13.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2235 -9.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9312 -10.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6389 -9.7898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3466 -10.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0543 -9.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3466 -11.0156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7609 -10.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4682 -9.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4686 -8.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7559 -8.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0516 -8.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3424 -8.5722 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.8877 -8.9804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0886 -8.8104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6800 -9.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2266 -10.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8673 -9.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
5 7 2 0
4 8 1 0
4 9 1 6
8 2 1 0
2 10 1 0
9 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
6 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 22 1 0
28 29 1 0
10 30 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 10 1 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.55Molecular Weight (Monoisotopic): 497.1744AlogP: 0.62#Rotatable Bonds: 10Polar Surface Area: 159.50Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.72CX Basic pKa: ┄CX LogP: 0.27CX LogD: 0.13Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -1.66
References 1. Zhan W, Visone J, Ouellette T, Harris JC, Wang R, Zhang H, Singh PK, Ginn J, Sukenick G, Wong TT, Okoro JI, Scales RM, Tumwebaze PK, Rosenthal PJ, Kafsack BFC, Cooper RA, Meinke PT, Kirkman LA, Lin G.. (2019) Improvement of Asparagine Ethylenediamines as Anti-malarial Plasmodium -Selective Proteasome Inhibitors., 62 (13): [PMID:31177777 ] [10.1021/acs.jmedchem.9b00363 ]