The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(5-(4-bromophenylsulfonamido)benzo[d]oxazol-2-yl)phenyl)-5-chlorothiophene-2-sulfonamide ID: ALA4548710
PubChem CID: 155549283
Max Phase: Preclinical
Molecular Formula: C23H15BrClN3O5S3
Molecular Weight: 624.95
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(Nc1ccc2oc(-c3ccc(NS(=O)(=O)c4ccc(Cl)s4)cc3)nc2c1)c1ccc(Br)cc1
Standard InChI: InChI=1S/C23H15BrClN3O5S3/c24-15-3-8-18(9-4-15)35(29,30)28-17-7-10-20-19(13-17)26-23(33-20)14-1-5-16(6-2-14)27-36(31,32)22-12-11-21(25)34-22/h1-13,27-28H
Standard InChI Key: BJXDSGPRGYPHOQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
43.0552 -14.2018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.0594 -13.3846 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.3496 -13.7896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8751 -12.4106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2878 -13.1205 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.6962 -12.4081 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7062 -12.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7050 -13.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4131 -13.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4113 -11.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9970 -13.5308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5809 -13.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1199 -12.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1247 -13.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9047 -13.3667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3821 -12.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8970 -12.0422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1992 -12.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6094 -13.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4258 -13.3987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8311 -12.6881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4139 -11.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5989 -11.9884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6483 -12.6822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.8766 -13.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3605 -14.0430 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
45.1377 -13.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1377 -12.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3605 -12.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7989 -14.2708 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.8699 -13.1265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1635 -13.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1675 -14.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8838 -14.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5873 -14.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4626 -14.7721 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 14 2 0
13 10 2 0
10 7 1 0
8 11 1 0
11 5 1 0
5 12 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 2 1 0
2 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 2 0
27 30 1 0
12 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 12 1 0
33 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 624.95Molecular Weight (Monoisotopic): 622.9046AlogP: 6.57#Rotatable Bonds: 7Polar Surface Area: 118.37Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.11CX Basic pKa: 0.82CX LogP: 5.81CX LogD: 4.83Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.21Np Likeness Score: -1.96
References 1. Washburn A, Abdeen S, Ovechkina Y, Ray AM, Stevens M, Chitre S, Sivinski J, Park Y, Johnson J, Hoang QQ, Chapman E, Parish T, Johnson SM.. (2019) Dual-targeting GroEL/ES chaperonin and protein tyrosine phosphatase B (PtpB) inhibitors: A polypharmacology strategy for treating Mycobacterium tuberculosis infections., 29 (13): [PMID:31047750 ] [10.1016/j.bmcl.2019.04.034 ]