The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(4-(3-acetamidophenyl)thiazol-2-yl)-N7-(2-aminophenyl)heptanediamide ID: ALA4548759
PubChem CID: 155549538
Max Phase: Preclinical
Molecular Formula: C24H27N5O3S
Molecular Weight: 465.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cccc(-c2csc(NC(=O)CCCCCC(=O)Nc3ccccc3N)n2)c1
Standard InChI: InChI=1S/C24H27N5O3S/c1-16(30)26-18-9-7-8-17(14-18)21-15-33-24(28-21)29-23(32)13-4-2-3-12-22(31)27-20-11-6-5-10-19(20)25/h5-11,14-15H,2-4,12-13,25H2,1H3,(H,26,30)(H,27,31)(H,28,29,32)
Standard InChI Key: UHRZIVFNXTZUIQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
21.7555 -23.9806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4689 -24.3906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1792 -23.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4719 -25.2119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8925 -24.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6028 -23.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3162 -24.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0265 -23.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7357 -24.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4460 -23.9592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7388 -25.1959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0452 -24.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2939 -24.0631 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7494 -24.6766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1607 -25.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9635 -25.2139 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.6975 -25.3839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5170 -25.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9281 -24.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5166 -23.9662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6939 -23.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2907 -24.6782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2827 -23.2587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1594 -24.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1604 -25.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8729 -25.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5842 -25.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5785 -24.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8654 -23.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8589 -23.1310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6886 -22.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2773 -21.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5099 -22.5464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
1 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
19 14 1 0
21 23 1 0
10 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
29 30 1 0
23 31 1 0
31 32 1 0
31 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.58Molecular Weight (Monoisotopic): 465.1835AlogP: 4.88#Rotatable Bonds: 10Polar Surface Area: 126.21Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.96CX Basic pKa: 3.47CX LogP: 3.59CX LogD: 3.49Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.25Np Likeness Score: -1.54
References 1. Amin SA, Adhikari N, Kotagiri S, Jha T, Ghosh B.. (2019) Histone deacetylase 3 inhibitors in learning and memory processes with special emphasis on benzamides., 166 [PMID:30735902 ] [10.1016/j.ejmech.2019.01.077 ]