5-(Benzo[d][1,3]dioxole-5-carboxamido)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic acid

ID: ALA4548774

PubChem CID: 155548879

Max Phase: Preclinical

Molecular Formula: C26H24N2O5

Molecular Weight: 444.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(NC(=O)c2ccc3c(c2)OCO3)cc(-c2ccc(C3CCNCC3)cc2)c1

Standard InChI:  InChI=1S/C26H24N2O5/c29-25(19-5-6-23-24(14-19)33-15-32-23)28-22-12-20(11-21(13-22)26(30)31)17-3-1-16(2-4-17)18-7-9-27-10-8-18/h1-6,11-14,18,27H,7-10,15H2,(H,28,29)(H,30,31)

Standard InChI Key:  MUFSGGGGNQTTID-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   24.0570  -13.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0558  -14.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7717  -14.8385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4892  -14.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4864  -13.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7699  -13.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7734  -15.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0561  -16.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0556  -16.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7715  -17.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4895  -16.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4866  -16.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7761  -18.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0592  -18.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0581  -19.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7723  -19.7857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4892  -19.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4919  -18.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1962  -13.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9133  -13.5864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1932  -12.3527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3413  -13.1848    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6259  -13.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9103  -13.1851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6261  -14.4212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9137  -12.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4853  -13.1892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2007  -13.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4825  -12.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1959  -11.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0258  -11.1407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2073  -11.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8741  -11.8072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  2  0
 19 21  1  0
  1 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  2  0
 26 30  1  0
 29 27  1  0
 27 28  2  0
 28 24  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548774

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.49Molecular Weight (Monoisotopic): 444.1685AlogP: 4.50#Rotatable Bonds: 5
Polar Surface Area: 96.89Molecular Species: ZWITTERIONHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.84CX Basic pKa: 10.07CX LogP: 1.63CX LogD: 1.63
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -0.62

References

1. Zhang Z, Hao K, Li H, Lu R, Liu C, Zhou M, Li B, Meng Z, Hu Q, Jiang C..  (2019)  Design, synthesis and anti-inflammatory evaluation of 3-amide benzoic acid derivatives as novel P2Y14 receptor antagonists.,  181  [PMID:31376563] [10.1016/j.ejmech.2019.111564]

Source