The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(Benzo[d][1,3]dioxole-5-carboxamido)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic acid ID: ALA4548774
PubChem CID: 155548879
Max Phase: Preclinical
Molecular Formula: C26H24N2O5
Molecular Weight: 444.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc(NC(=O)c2ccc3c(c2)OCO3)cc(-c2ccc(C3CCNCC3)cc2)c1
Standard InChI: InChI=1S/C26H24N2O5/c29-25(19-5-6-23-24(14-19)33-15-32-23)28-22-12-20(11-21(13-22)26(30)31)17-3-1-16(2-4-17)18-7-9-27-10-8-18/h1-6,11-14,18,27H,7-10,15H2,(H,28,29)(H,30,31)
Standard InChI Key: MUFSGGGGNQTTID-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
24.0570 -13.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0558 -14.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7717 -14.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4892 -14.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4864 -13.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7699 -13.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7734 -15.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0561 -16.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0556 -16.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7715 -17.3126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4895 -16.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4866 -16.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7761 -18.1354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0592 -18.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0581 -19.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7723 -19.7857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4892 -19.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4919 -18.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1962 -13.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9133 -13.5864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1932 -12.3527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3413 -13.1848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6259 -13.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9103 -13.1851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6261 -14.4212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9137 -12.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4853 -13.1892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2007 -13.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4825 -12.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1959 -11.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0258 -11.1407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2073 -11.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8741 -11.8072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
10 13 1 0
5 19 1 0
19 20 2 0
19 21 1 0
1 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 30 1 0
29 27 1 0
27 28 2 0
28 24 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.49Molecular Weight (Monoisotopic): 444.1685AlogP: 4.50#Rotatable Bonds: 5Polar Surface Area: 96.89Molecular Species: ZWITTERIONHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.84CX Basic pKa: 10.07CX LogP: 1.63CX LogD: 1.63Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -0.62
References 1. Zhang Z, Hao K, Li H, Lu R, Liu C, Zhou M, Li B, Meng Z, Hu Q, Jiang C.. (2019) Design, synthesis and anti-inflammatory evaluation of 3-amide benzoic acid derivatives as novel P2Y14 receptor antagonists., 181 [PMID:31376563 ] [10.1016/j.ejmech.2019.111564 ]