2-(3-(4-fluorobenzamido)phenyl)-4-((4-(morpholine-4-carbonyl)phenyl)amino)thiazole-5-carboxamide

ID: ALA4548804

PubChem CID: 155548954

Max Phase: Preclinical

Molecular Formula: C28H24FN5O4S

Molecular Weight: 545.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)c1sc(-c2cccc(NC(=O)c3ccc(F)cc3)c2)nc1Nc1ccc(C(=O)N2CCOCC2)cc1

Standard InChI:  InChI=1S/C28H24FN5O4S/c29-20-8-4-17(5-9-20)26(36)32-22-3-1-2-19(16-22)27-33-25(23(39-27)24(30)35)31-21-10-6-18(7-11-21)28(37)34-12-14-38-15-13-34/h1-11,16,31H,12-15H2,(H2,30,35)(H,32,36)

Standard InChI Key:  PQAYCOHGNVZBLK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   16.6736  -10.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6723  -11.4939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3872  -11.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1036  -11.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1008  -10.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3854  -10.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8136  -10.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5297  -10.6575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8106   -9.4228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2426  -10.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9570  -10.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6694  -10.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6668   -9.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9457   -9.0056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2363   -9.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3852  -10.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4708  -11.4695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2783  -11.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6885  -10.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1344  -10.3114    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.6163  -12.3910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4371  -12.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7718  -13.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5917  -13.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0753  -12.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7332  -11.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9142  -11.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5101  -10.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9972  -11.4968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8431  -10.0762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8962  -12.7225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2353  -13.4746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3780  -12.0528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7519  -14.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0877  -14.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9085  -14.9756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3924  -14.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0556  -13.5503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9576  -11.9058    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 12 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 28 30  1  0
 19 28  1  0
 25 31  1  0
 31 32  1  0
 31 33  2  0
 32 34  1  0
 32 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
  2 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548804

    ---

Associated Targets(Human)

Raji (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ramos (1218 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.60Molecular Weight (Monoisotopic): 545.1533AlogP: 4.52#Rotatable Bonds: 7
Polar Surface Area: 126.65Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.79CX Basic pKa: CX LogP: 5.29CX LogD: 5.29
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: -1.97

References

1. Guo X, Yang D, Fan Z, Zhang N, Zhao B, Huang C, Wang F, Ma R, Meng M, Deng Y..  (2019)  Discovery and structure-activity relationship of novel diphenylthiazole derivatives as BTK inhibitor with potent activity against B cell lymphoma cell lines.,  178  [PMID:31234030] [10.1016/j.ejmech.2019.06.035]

Source