The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-fluorobenzamido)phenyl)-4-((4-(morpholine-4-carbonyl)phenyl)amino)thiazole-5-carboxamide ID: ALA4548804
PubChem CID: 155548954
Max Phase: Preclinical
Molecular Formula: C28H24FN5O4S
Molecular Weight: 545.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1sc(-c2cccc(NC(=O)c3ccc(F)cc3)c2)nc1Nc1ccc(C(=O)N2CCOCC2)cc1
Standard InChI: InChI=1S/C28H24FN5O4S/c29-20-8-4-17(5-9-20)26(36)32-22-3-1-2-19(16-22)27-33-25(23(39-27)24(30)35)31-21-10-6-18(7-11-21)28(37)34-12-14-38-15-13-34/h1-11,16,31H,12-15H2,(H2,30,35)(H,32,36)
Standard InChI Key: PQAYCOHGNVZBLK-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
16.6736 -10.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6723 -11.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3872 -11.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1036 -11.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1008 -10.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3854 -10.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8136 -10.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5297 -10.6575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8106 -9.4228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2426 -10.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9570 -10.6556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6694 -10.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6668 -9.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9457 -9.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2363 -9.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3852 -10.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4708 -11.4695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2783 -11.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6885 -10.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1344 -10.3114 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.6163 -12.3910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4371 -12.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7718 -13.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5917 -13.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0753 -12.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7332 -11.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9142 -11.8045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5101 -10.8310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9972 -11.4968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8431 -10.0762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8962 -12.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2353 -13.4746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3780 -12.0528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7519 -14.1392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0877 -14.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9085 -14.9756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3924 -14.3063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0556 -13.5503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9576 -11.9058 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
12 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 1 0
18 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
28 29 2 0
28 30 1 0
19 28 1 0
25 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
32 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
2 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.60Molecular Weight (Monoisotopic): 545.1533AlogP: 4.52#Rotatable Bonds: 7Polar Surface Area: 126.65Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.79CX Basic pKa: ┄CX LogP: 5.29CX LogD: 5.29Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: -1.97
References 1. Guo X, Yang D, Fan Z, Zhang N, Zhao B, Huang C, Wang F, Ma R, Meng M, Deng Y.. (2019) Discovery and structure-activity relationship of novel diphenylthiazole derivatives as BTK inhibitor with potent activity against B cell lymphoma cell lines., 178 [PMID:31234030 ] [10.1016/j.ejmech.2019.06.035 ]