The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Chloro-4-(4-octylpiperazine-1-carboxamido)phenyl sulfamate ID: ALA4548819
PubChem CID: 155549060
Max Phase: Preclinical
Molecular Formula: C19H31ClN4O4S
Molecular Weight: 447.00
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCN1CCN(C(=O)Nc2ccc(OS(N)(=O)=O)cc2Cl)CC1
Standard InChI: InChI=1S/C19H31ClN4O4S/c1-2-3-4-5-6-7-10-23-11-13-24(14-12-23)19(25)22-18-9-8-16(15-17(18)20)28-29(21,26)27/h8-9,15H,2-7,10-14H2,1H3,(H,22,25)(H2,21,26,27)
Standard InChI Key: AMECXYMZGVQWOG-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
9.9507 -22.0724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5463 -21.3667 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.1373 -22.0698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7177 -21.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7166 -22.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4246 -22.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1343 -22.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1314 -21.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4228 -20.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0085 -22.6066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3011 -22.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5931 -22.6055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3018 -21.3802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8885 -22.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1826 -22.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1777 -23.4131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8849 -23.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5970 -23.4182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8376 -20.9641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2530 -20.9588 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4681 -23.8185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4644 -24.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1702 -25.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8798 -24.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5856 -25.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2952 -24.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0010 -25.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7106 -24.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0099 -20.9706 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
12 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
8 19 1 0
19 2 1 0
2 20 1 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
4 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.00Molecular Weight (Monoisotopic): 446.1755AlogP: 3.43#Rotatable Bonds: 10Polar Surface Area: 104.97Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.63CX Basic pKa: 7.60CX LogP: 3.52CX LogD: 3.11Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.54Np Likeness Score: -1.57
References 1. Moi D, Foster PA, Rimmer LG, Jaffri A, Deplano A, Balboni G, Onnis V, Potter BVL.. (2019) Synthesis and in vitro evaluation of piperazinyl-ureido sulfamates as steroid sulfatase inhibitors., 182 [PMID:31422224 ] [10.1016/j.ejmech.2019.111614 ]