The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((2,6-dichlorophenyl)(3-(2-methylpyrimidin-5-yl)prop-2-yn-1-yl)amino)-3-methylquinazolin-4(3H)-one ID: ALA4548823
PubChem CID: 155549063
Max Phase: Preclinical
Molecular Formula: C23H17Cl2N5O
Molecular Weight: 450.33
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ncc(C#CCN(c2ccc3ncn(C)c(=O)c3c2)c2c(Cl)cccc2Cl)cn1
Standard InChI: InChI=1S/C23H17Cl2N5O/c1-15-26-12-16(13-27-15)5-4-10-30(22-19(24)6-3-7-20(22)25)17-8-9-21-18(11-17)23(31)29(2)14-28-21/h3,6-9,11-14H,10H2,1-2H3
Standard InChI Key: IFRBXECGVFNHIN-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
12.7930 -8.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5017 -8.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5008 -7.5816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7913 -7.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0868 -7.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3772 -7.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6686 -7.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6695 -8.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3790 -8.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0876 -8.4003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7904 -6.3566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2095 -7.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9590 -7.1768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2545 -7.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5450 -7.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8396 -6.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7151 -5.5429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7160 -6.3601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4214 -6.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1301 -6.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -5.5414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4197 -5.1335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0056 -5.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9623 -6.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6668 -5.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6659 -5.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9605 -4.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2519 -5.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2528 -5.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5441 -6.3570 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.3764 -6.3581 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
4 11 2 0
3 12 1 0
14 15 1 0
15 16 3 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
17 23 1 0
16 20 1 0
13 14 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
29 30 1 0
25 31 1 0
13 24 1 0
7 13 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.33Molecular Weight (Monoisotopic): 449.0810AlogP: 4.53#Rotatable Bonds: 3Polar Surface Area: 63.91Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.54CX LogP: 4.16CX LogD: 4.11Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -1.15
References 1. Scheufler C, Möbitz H, Gaul C, Ragot C, Be C, Fernández C, Beyer KS, Tiedt R, Stauffer F.. (2016) Optimization of a Fragment-Based Screening Hit toward Potent DOT1L Inhibitors Interacting in an Induced Binding Pocket., 7 (8): [PMID:27563394 ] [10.1021/acsmedchemlett.6b00168 ]