The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3-(3-carbamothioylphenyl)-1-(tetrahydro-2H-pyran-4-yl)-1H-indol-6-yl)methyl)-2-(1H-imidazol-4-yl)acetamide ID: ALA4548847
PubChem CID: 138636803
Max Phase: Preclinical
Molecular Formula: C26H27N5O2S
Molecular Weight: 473.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=S)c1cccc(-c2cn(C3CCOCC3)c3cc(CNC(=O)Cc4c[nH]cn4)ccc23)c1
Standard InChI: InChI=1S/C26H27N5O2S/c27-26(34)19-3-1-2-18(11-19)23-15-31(21-6-8-33-9-7-21)24-10-17(4-5-22(23)24)13-29-25(32)12-20-14-28-16-30-20/h1-5,10-11,14-16,21H,6-9,12-13H2,(H2,27,34)(H,28,30)(H,29,32)
Standard InChI Key: OHSAIJCQSBWIQY-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
11.4475 -2.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4794 -3.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2081 -4.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8971 -3.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2491 -4.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5820 -5.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8467 -6.2297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9124 -5.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6609 -6.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2087 -6.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7073 -5.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2568 -5.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0019 -6.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5493 -7.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3718 -6.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1444 -2.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8577 -2.8955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5434 -2.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2640 -2.8544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5166 -1.6524 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5604 -6.8128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0860 -7.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4208 -8.2197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2349 -8.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7143 -7.6354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3485 -7.0954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8959 -7.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6951 -7.5314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6442 -8.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1916 -9.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0251 -9.8857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7332 -10.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3400 -9.7462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0068 -9.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 17 1 0
16 1 1 0
3 5 1 0
5 6 2 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
9 10 1 0
10 13 2 0
12 11 2 0
11 8 1 0
12 13 1 0
13 14 1 0
7 15 1 0
16 17 2 0
17 18 1 0
18 19 1 0
18 20 2 0
15 21 1 0
15 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
14 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.60Molecular Weight (Monoisotopic): 473.1885AlogP: 3.88#Rotatable Bonds: 7Polar Surface Area: 97.96Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.51CX Basic pKa: 6.39CX LogP: 2.69CX LogD: 2.65Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -1.00
References 1. (2017) Ash1l inhibitors and methods of treatment therewith,