N-((3-(3-carbamothioylphenyl)-1-(tetrahydro-2H-pyran-4-yl)-1H-indol-6-yl)methyl)-2-(1H-imidazol-4-yl)acetamide

ID: ALA4548847

PubChem CID: 138636803

Max Phase: Preclinical

Molecular Formula: C26H27N5O2S

Molecular Weight: 473.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=S)c1cccc(-c2cn(C3CCOCC3)c3cc(CNC(=O)Cc4c[nH]cn4)ccc23)c1

Standard InChI:  InChI=1S/C26H27N5O2S/c27-26(34)19-3-1-2-18(11-19)23-15-31(21-6-8-33-9-7-21)24-10-17(4-5-22(23)24)13-29-25(32)12-20-14-28-16-30-20/h1-5,10-11,14-16,21H,6-9,12-13H2,(H2,27,34)(H,28,30)(H,29,32)

Standard InChI Key:  OHSAIJCQSBWIQY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   11.4475   -2.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4794   -3.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2081   -4.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8971   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2491   -4.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5820   -5.4607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8467   -6.2297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9124   -5.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6609   -6.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2087   -6.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7073   -5.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2568   -5.8855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0019   -6.6594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493   -7.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3718   -6.8948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1444   -2.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8577   -2.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5434   -2.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2640   -2.8544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5166   -1.6524    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.5604   -6.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0860   -7.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4208   -8.2197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2349   -8.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7143   -7.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3485   -7.0954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8959   -7.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6951   -7.5314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6442   -8.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1916   -9.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0251   -9.8857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7332  -10.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3400   -9.7462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0068   -9.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 17  1  0
 16  1  1  0
  3  5  1  0
  5  6  2  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  9 10  1  0
 10 13  2  0
 12 11  2  0
 11  8  1  0
 12 13  1  0
 13 14  1  0
  7 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 15 21  1  0
 15 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 14 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4548847

    ---

Associated Targets(Human)

ASH1L Tbio Histone-lysine N-methyltransferase ASH1L (468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 473.60Molecular Weight (Monoisotopic): 473.1885AlogP: 3.88#Rotatable Bonds: 7
Polar Surface Area: 97.96Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.51CX Basic pKa: 6.39CX LogP: 2.69CX LogD: 2.65
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -1.00

References

1.  (2017)  Ash1l inhibitors and methods of treatment therewith, 

Source