The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
oxetan-3-ylmethyl 2-{4-[(1R)-1-[(4-chloro-1,6-dimethyl-1H-indol-2-yl)formamido]ethyl]benzenesulfonyl}acetate ID: ALA4548851
PubChem CID: 142427661
Max Phase: Preclinical
Molecular Formula: C25H27ClN2O6S
Molecular Weight: 519.02
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Cl)c2cc(C(=O)N[C@H](C)c3ccc(S(=O)(=O)CC(=O)OCC4COC4)cc3)n(C)c2c1
Standard InChI: InChI=1S/C25H27ClN2O6S/c1-15-8-21(26)20-10-23(28(3)22(20)9-15)25(30)27-16(2)18-4-6-19(7-5-18)35(31,32)14-24(29)34-13-17-11-33-12-17/h4-10,16-17H,11-14H2,1-3H3,(H,27,30)/t16-/m1/s1
Standard InChI Key: PXBBZULQZPUARL-MRXNPFEDSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
17.9658 -4.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6109 -6.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1445 -5.7740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1486 -4.9568 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.4389 -5.3618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7860 -3.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4941 -3.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2009 -2.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2057 -3.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9857 -3.5233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4631 -2.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9780 -2.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2803 -2.8533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6930 -3.5586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6847 -2.1432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5018 -2.1384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9063 -1.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9146 -2.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5073 -3.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9193 -4.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7374 -4.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1416 -3.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7272 -2.8368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2428 -4.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3815 -5.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1987 -5.6438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9801 -6.3639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7872 -2.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4912 -2.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4883 -1.2349 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.0780 -3.6874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4281 -6.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0052 -6.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5802 -6.3402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9995 -5.7652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 3 2 0
5 4 2 0
28 6 2 0
6 7 1 0
7 9 2 0
8 29 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
11 13 1 0
13 14 2 0
13 15 1 0
16 15 1 6
16 17 1 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 4 1 0
4 1 1 0
10 24 1 0
1 25 1 0
25 26 1 0
25 27 2 0
28 29 1 0
2 26 1 0
29 30 1 0
6 31 1 0
2 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.02Molecular Weight (Monoisotopic): 518.1278AlogP: 3.59#Rotatable Bonds: 8Polar Surface Area: 103.70Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.44CX Basic pKa: ┄CX LogP: 3.30CX LogD: 3.30Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -1.27
References 1. (2018) Tosylacetate based compounds and derivatives thereof as phgdh inhibitors,