oxetan-3-ylmethyl 2-{4-[(1R)-1-[(4-chloro-1,6-dimethyl-1H-indol-2-yl)formamido]ethyl]benzenesulfonyl}acetate

ID: ALA4548851

PubChem CID: 142427661

Max Phase: Preclinical

Molecular Formula: C25H27ClN2O6S

Molecular Weight: 519.02

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(Cl)c2cc(C(=O)N[C@H](C)c3ccc(S(=O)(=O)CC(=O)OCC4COC4)cc3)n(C)c2c1

Standard InChI:  InChI=1S/C25H27ClN2O6S/c1-15-8-21(26)20-10-23(28(3)22(20)9-15)25(30)27-16(2)18-4-6-19(7-5-18)35(31,32)14-24(29)34-13-17-11-33-12-17/h4-10,16-17H,11-14H2,1-3H3,(H,27,30)/t16-/m1/s1

Standard InChI Key:  PXBBZULQZPUARL-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   17.9658   -4.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6109   -6.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1445   -5.7740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1486   -4.9568    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.4389   -5.3618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7860   -3.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4941   -3.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2009   -2.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2057   -3.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9857   -3.5233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4631   -2.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9780   -2.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2803   -2.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6930   -3.5586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6847   -2.1432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5018   -2.1384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9063   -1.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9146   -2.8437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5073   -3.5533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9193   -4.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7374   -4.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1416   -3.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7272   -2.8368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2428   -4.2990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3815   -5.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1987   -5.6438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9801   -6.3639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7872   -2.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4912   -2.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4883   -1.2349    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.0780   -3.6874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4281   -6.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0052   -6.9209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5802   -6.3402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9995   -5.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  3  2  0
  5  4  2  0
 28  6  2  0
  6  7  1  0
  7  9  2  0
  8 29  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 11 13  1  0
 13 14  2  0
 13 15  1  0
 16 15  1  6
 16 17  1  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21  4  1  0
  4  1  1  0
 10 24  1  0
  1 25  1  0
 25 26  1  0
 25 27  2  0
 28 29  1  0
  2 26  1  0
 29 30  1  0
  6 31  1  0
  2 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548851

    ---

Associated Targets(Human)

PHGDH Tchem D-3-phosphoglycerate dehydrogenase (883 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.02Molecular Weight (Monoisotopic): 518.1278AlogP: 3.59#Rotatable Bonds: 8
Polar Surface Area: 103.70Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.44CX Basic pKa: CX LogP: 3.30CX LogD: 3.30
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -1.27

References

1.  (2018)  Tosylacetate based compounds and derivatives thereof as phgdh inhibitors, 

Source