The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-16-(3'-nitrobenzylidene)-3-hydroxy-2-methoxyestra-1,3,5(10)trien-17-one ID: ALA4548905
PubChem CID: 155548899
Max Phase: Preclinical
Molecular Formula: C26H27NO5
Molecular Weight: 433.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1O)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)/C(=C/c3cccc([N+](=O)[O-])c3)C[C@@H]12
Standard InChI: InChI=1S/C26H27NO5/c1-26-9-8-19-20(7-6-16-13-23(28)24(32-2)14-21(16)19)22(26)12-17(25(26)29)10-15-4-3-5-18(11-15)27(30)31/h3-5,10-11,13-14,19-20,22,28H,6-9,12H2,1-2H3/b17-10+/t19-,20+,22-,26-/m0/s1
Standard InChI Key: GYSZPAFLWSBANR-NGUNZVQRSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
38.8483 -10.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8472 -11.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5589 -12.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5571 -10.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2696 -10.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2684 -11.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9823 -12.0193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7019 -11.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9846 -10.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7030 -10.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7135 -9.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9867 -9.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4318 -9.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4231 -10.3714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2106 -10.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7063 -9.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2248 -9.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1353 -12.0139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.4869 -8.5134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4264 -8.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6961 -9.9582 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
42.4181 -11.1906 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
40.9783 -11.1782 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.1367 -10.3692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1365 -9.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5277 -9.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9311 -10.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5081 -11.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9108 -12.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7332 -12.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1513 -11.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7463 -10.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.9758 -11.4140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
47.3915 -10.7053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.3816 -12.1283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 1 0
11 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
2 18 1 0
17 19 2 0
13 20 1 1
10 21 1 1
14 22 1 6
9 23 1 6
1 24 1 0
24 25 1 0
16 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
33 34 2 0
33 35 1 0
31 33 1 0
M CHG 2 33 1 35 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.50Molecular Weight (Monoisotopic): 433.1889AlogP: 5.43#Rotatable Bonds: 3Polar Surface Area: 89.67Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.29CX Basic pKa: ┄CX LogP: 6.15CX LogD: 6.15Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: 0.63
References 1. Wang C, Li L, Fu D, Qin T, Ran Y, Xu F, Du X, Gao H, Sun S, Yang T, Zhang X, Huo J, Zhao W, Zhang Z, Shi X.. (2019) Discovery of chalcone-modified estradiol analogs as antitumour agents that Inhibit tumour angiogenesis and epithelial to mesenchymal transition., 176 [PMID:31102934 ] [10.1016/j.ejmech.2019.04.071 ]