3-(1-(3,3-difluoropropyl)-6-(1,2-dihydroxyethyl)-1H-indol-3-yl)benzothioamide

ID: ALA4548999

PubChem CID: 132137467

Max Phase: Preclinical

Molecular Formula: C20H20F2N2O2S

Molecular Weight: 390.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=S)c1cccc(-c2cn(CCC(F)F)c3cc(C(O)CO)ccc23)c1

Standard InChI:  InChI=1S/C20H20F2N2O2S/c21-19(22)6-7-24-10-16(12-2-1-3-14(8-12)20(23)27)15-5-4-13(9-17(15)24)18(26)11-25/h1-5,8-10,18-19,25-26H,6-7,11H2,(H2,23,27)

Standard InChI Key:  OJXXZRBFQREOJT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   14.1756   -5.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1745   -6.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8825   -7.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5922   -6.6962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5893   -5.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8807   -5.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2955   -5.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0048   -5.8682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8823   -7.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2924   -4.6451    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.2234   -8.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4758   -9.1766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5456   -8.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2941   -9.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8378   -9.7757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6330   -9.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8817   -8.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3364   -8.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9967   -9.8386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3305  -10.5845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8515  -11.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1815  -10.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9804  -10.0396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0386  -11.1627    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.1853  -11.9925    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.9312  -10.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4797  -11.5954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  3  9  1  0
  7 10  2  0
  9 11  2  0
 11 12  1  0
 12 14  1  0
 13  9  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 12 19  1  0
 19 20  1  0
 20 21  1  0
 16 22  1  0
 22 23  1  0
 21 24  1  0
 21 25  1  0
 22 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4548999

    ---

Associated Targets(Human)

ASH1L Tbio Histone-lysine N-methyltransferase ASH1L (468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 390.46Molecular Weight (Monoisotopic): 390.1214AlogP: 3.62#Rotatable Bonds: 7
Polar Surface Area: 71.41Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.63CX Basic pKa: CX LogP: 3.02CX LogD: 3.02
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.54Np Likeness Score: -0.62

References

1.  (2017)  Ash1l inhibitors and methods of treatment therewith, 

Source