The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methyl-3-(3-(4-(4-methylpiperazin-1-yl)phenyl)-1H-indazol-6-yl)-N-(3-(trifluoromethyl)phenyl)benzamide ID: ALA4549057
PubChem CID: 155549158
Max Phase: Preclinical
Molecular Formula: C33H30F3N5O
Molecular Weight: 569.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1-c1ccc2c(-c3ccc(N4CCN(C)CC4)cc3)n[nH]c2c1
Standard InChI: InChI=1S/C33H30F3N5O/c1-21-6-7-24(32(42)37-26-5-3-4-25(20-26)33(34,35)36)18-29(21)23-10-13-28-30(19-23)38-39-31(28)22-8-11-27(12-9-22)41-16-14-40(2)15-17-41/h3-13,18-20H,14-17H2,1-2H3,(H,37,42)(H,38,39)
Standard InChI Key: BYQLDKXFUZAGSM-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
17.8087 -2.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5184 -1.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5155 -0.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8069 -0.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2187 -0.5769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9282 -0.9846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6339 -0.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6313 0.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9170 0.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2143 0.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5039 0.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3429 -0.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3456 -1.7974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0493 -0.5693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7584 -0.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7575 -1.7923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4657 -2.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1730 -1.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1677 -0.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4589 -0.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1007 -1.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1019 -0.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3257 -0.7400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8447 -1.3999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3237 -2.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8751 -0.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5165 -0.1726 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.6754 -0.8468 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.0056 0.2991 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.0726 -2.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2716 -3.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0179 -3.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5640 -4.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3672 -4.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6172 -3.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3149 -5.1625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5142 -5.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2608 -6.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8047 -6.7142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6053 -6.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8622 -5.7676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5491 -7.4904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 22 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 5 1 0
10 11 1 0
7 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
26 27 1 0
26 28 1 0
26 29 1 0
19 26 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
25 30 1 0
36 37 1 0
36 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
33 36 1 0
39 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.63Molecular Weight (Monoisotopic): 569.2402AlogP: 7.23#Rotatable Bonds: 5Polar Surface Area: 64.26Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.87CX Basic pKa: 7.81CX LogP: 7.41CX LogD: 6.86Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -1.53
References 1. Wang Q, Dai Y, Ji Y, Shi H, Guo Z, Chen D, Chen Y, Peng X, Gao Y, Wang X, Chen L, Jiang Y, Geng M, Shen J, Ai J, Xiong B.. (2019) Discovery and optimization of a series of 3-substituted indazole derivatives as multi-target kinase inhibitors for the treatment of lung squamous cell carcinoma., 163 [PMID:30572178 ] [10.1016/j.ejmech.2018.12.015 ]