N-(4-Bromophenyl)-7-((2,4-difluorophenyl)sulfonyl)-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidin-4-amine

ID: ALA4549130

PubChem CID: 155549543

Max Phase: Preclinical

Molecular Formula: C21H15BrF2N4O2S2

Molecular Weight: 537.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(c1ccc(F)cc1F)N1CCc2c(sc3ncnc(Nc4ccc(Br)cc4)c23)C1

Standard InChI:  InChI=1S/C21H15BrF2N4O2S2/c22-12-1-4-14(5-2-12)27-20-19-15-7-8-28(10-17(15)31-21(19)26-11-25-20)32(29,30)18-6-3-13(23)9-16(18)24/h1-6,9,11H,7-8,10H2,(H,25,26,27)

Standard InChI Key:  AHJFXRUQRQDAHT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    3.1243  -12.7985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1284  -11.9813    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4187  -12.3864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7578   -9.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7566  -10.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4647  -11.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1743  -10.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1715   -9.9471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4629   -9.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0486  -11.1783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0479  -11.9955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0467  -13.6284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7571  -13.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7546  -12.4009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3388  -13.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3357  -12.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5637  -13.4734    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0816  -12.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5601  -12.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2318  -11.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4240  -11.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9458  -11.9879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2748  -12.7336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7248  -11.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1416  -10.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7384   -9.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9204   -9.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5071  -10.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9126  -11.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9587  -10.5757    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5157   -9.1423    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.8777   -9.5359    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10 11  1  0
 11 16  2  0
 15 12  2  0
 12 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  1  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22  2  1  0
  2 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 25 30  1  0
 27 31  1  0
  8 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4549130

    ---

Associated Targets(Human)

SUNE1 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MKNK1 Tchem MAP kinase-interacting serine/threonine-protein kinase MNK1 (2071 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
786-0 (47912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.41Molecular Weight (Monoisotopic): 535.9788AlogP: 5.22#Rotatable Bonds: 4
Polar Surface Area: 75.19Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.54CX LogP: 5.33CX LogD: 5.33
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -2.42

References

1. Zhang M, Jiang L, Tao J, Pan Z, He M, Su D, He G, Jiang Q..  (2019)  Design, synthesis and biological evaluation of 4-aniline-thieno[2,3-d]pyrimidine derivatives as MNK1 inhibitors against renal cell carcinoma and nasopharyngeal carcinoma.,  27  (11): [PMID:31014565] [10.1016/j.bmc.2019.04.022]

Source