Difficidin

ID: ALA4549198

PubChem CID: 155549292

Max Phase: Preclinical

Molecular Formula: C35H51O6P

Molecular Weight: 598.76

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C/C=C(\C)CCC1CCC/C=C\C=C(\C)C(OP(=O)(O)O)CCC/C=C\C=C/C=C/C=C/CC(C)C(=C)CC(=O)O1

Standard InChI:  InChI=1S/C35H51O6P/c1-6-21-29(2)26-27-33-24-19-16-15-18-23-31(4)34(41-42(37,38)39)25-20-14-12-10-8-7-9-11-13-17-22-30(3)32(5)28-35(36)40-33/h6-13,15,17-18,21,23,30,33-34H,1,5,14,16,19-20,22,24-28H2,2-4H3,(H2,37,38,39)/b8-7-,11-9+,12-10-,17-13+,18-15-,29-21+,31-23-

Standard InChI Key:  CXPJULPBBFNORM-FAUFFIBHSA-N

Molfile:  

 
     RDKit          2D

 42 42  0  0  0  0  0  0  0  0999 V2000
    3.7104   -3.8713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7104   -4.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1209   -3.8713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4157   -3.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1209   -4.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4137   -5.0895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8219   -5.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2286   -5.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5285   -4.6962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4097   -5.8948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7040   -6.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6893   -7.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3850   -7.5129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3675   -8.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0639   -8.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0452   -9.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7350   -9.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4424   -9.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1274  -10.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8402   -9.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8600   -8.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5682   -8.4312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5966   -7.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9116   -7.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2160   -5.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9172   -6.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4079   -4.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3172   -7.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0113   -7.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7319   -7.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4259   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7584   -6.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1465   -7.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8406   -7.7626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1643   -8.3813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4622   -8.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1027  -10.8182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8298   -3.4648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8322   -2.6476    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    6.5411   -2.2411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1257   -2.2370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5375   -3.0541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  6  1  0
  5  3  1  0
  3  4  1  0
  5  7  2  0
  6 10  2  0
  7  9  1  0
  8  9  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 26  1  0
  8 25  1  0
 25 26  1  0
  5 27  1  0
 23 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 30 32  1  0
 31 33  1  0
 33 34  2  0
 21 35  2  0
 18 36  1  0
 19 37  2  0
  3 38  1  0
 38 39  1  0
 39 40  2  0
 39 41  1  0
 39 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4549198

    ---

Associated Targets(non-human)

Salmonella typhimurium (15756 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus aureus (210822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Morganella morganii (1291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 598.76Molecular Weight (Monoisotopic): 598.3423AlogP: 9.34#Rotatable Bonds: 6
Polar Surface Area: 93.06Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.88CX Basic pKa: CX LogP: 8.72CX LogD: 5.74
Aromatic Rings: Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: 1.65

References

1. Kaspar F, Neubauer P, Gimpel M..  (2019)  Bioactive Secondary Metabolites from Bacillus subtilis: A Comprehensive Review.,  82  (7): [PMID:31287310] [10.1021/acs.jnatprod.9b00110]

Source