The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Polygalatenoside E ID: ALA4549201
PubChem CID: 155549332
Max Phase: Preclinical
Molecular Formula: C22H32O13
Molecular Weight: 504.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/CO)cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[C@@H]2OC[C@](O)(CO)[C@H]2O)c1OC
Standard InChI: InChI=1S/C22H32O13/c1-30-12-6-11(4-3-5-23)7-13(17(12)31-2)33-20-18(16(27)15(26)14(8-24)34-20)35-21-19(28)22(29,9-25)10-32-21/h3-4,6-7,14-16,18-21,23-29H,5,8-10H2,1-2H3/b4-3+/t14-,15-,16+,18-,19+,20-,21+,22-/m1/s1
Standard InChI Key: ZGEJPEQJDSHJDX-RFBWFMNOSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
17.3232 -2.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3221 -3.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0369 -3.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7533 -3.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7505 -2.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0350 -1.9338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4633 -1.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1794 -2.3377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8922 -1.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6083 -2.3322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0367 -4.4118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6087 -1.9343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6085 -1.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6073 -3.5859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8932 -3.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3221 -4.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6121 -4.4089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8997 -4.8178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8953 -5.6430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6095 -6.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3281 -5.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1870 -4.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4708 -4.8120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1792 -6.0526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6065 -6.8828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0431 -6.0590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0441 -6.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3751 -7.3645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6274 -8.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4523 -8.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7099 -7.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9364 -8.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5997 -9.5712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4233 -8.2772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4947 -7.1103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7586 -6.4694 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
3 11 1 0
1 12 1 0
12 13 1 0
2 14 1 0
14 15 1 0
16 11 1 1
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
18 22 1 1
22 23 1 0
19 24 1 6
20 25 1 1
21 26 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
30 32 1 1
32 33 1 0
30 34 1 0
31 35 1 6
27 36 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.49Molecular Weight (Monoisotopic): 504.1843AlogP: -2.65#Rotatable Bonds: 10Polar Surface Area: 196.99Molecular Species: NEUTRALHBA: 13HBD: 7#RO5 Violations: 3HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.81CX Basic pKa: ┄CX LogP: -2.35CX LogD: -2.35Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: 2.36
References 1. Thao NP, Luyen BT, Vinh le B, Lee JY, Kwon YI, Kim YH.. (2016) Rat intestinal sucrase inhibited by minor constituents from the leaves and twigs of Archidendron clypearia (Jack.) Nielsen., 26 (17): [PMID:27481560 ] [10.1016/j.bmcl.2016.07.044 ]