The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(4-(3-(4-chlorophenyl)acryloyl)phenoxy)propylpiperidine-1-carbodithioate ID: ALA4549246
PubChem CID: 155550399
Max Phase: Preclinical
Molecular Formula: C24H26ClNO2S2
Molecular Weight: 460.06
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc(Cl)cc1)c1ccc(OCCCSC(=S)N2CCCCC2)cc1
Standard InChI: InChI=1S/C24H26ClNO2S2/c25-21-10-5-19(6-11-21)7-14-23(27)20-8-12-22(13-9-20)28-17-4-18-30-24(29)26-15-2-1-3-16-26/h5-14H,1-4,15-18H2/b14-7+
Standard InChI Key: QWENHADYUHFDMO-VGOFMYFVSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
27.8670 -7.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5748 -6.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2825 -7.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5748 -5.9061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9902 -6.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6979 -7.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6956 -7.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4024 -8.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1111 -7.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1085 -7.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4011 -6.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1598 -6.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4526 -7.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4521 -7.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1648 -8.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8691 -7.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7450 -8.3559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0367 -7.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3295 -8.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6213 -7.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9141 -8.3596 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.2059 -7.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4987 -8.3615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2048 -7.1348 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.7943 -7.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0892 -8.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0861 -9.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7942 -9.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5054 -9.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8194 -8.3576 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
1 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 1 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
23 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
9 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.06Molecular Weight (Monoisotopic): 459.1093AlogP: 6.51#Rotatable Bonds: 8Polar Surface Area: 29.54Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.65CX LogD: 6.65Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.19Np Likeness Score: -0.92
References 1. Fu DJ, Zhang SY, Liu YC, Zhang L, Liu JJ, Song J, Zhao RH, Li F, Sun HH, Liu HM, Zhang YB.. (2016) Design, synthesis and antiproliferative activity studies of novel dithiocarbamate-chalcone derivates., 26 (16): [PMID:27423479 ] [10.1016/j.bmcl.2016.07.012 ]