(E)-3-(4-(3-(4-chlorophenyl)acryloyl)phenoxy)propylpiperidine-1-carbodithioate

ID: ALA4549246

PubChem CID: 155550399

Max Phase: Preclinical

Molecular Formula: C24H26ClNO2S2

Molecular Weight: 460.06

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccc(Cl)cc1)c1ccc(OCCCSC(=S)N2CCCCC2)cc1

Standard InChI:  InChI=1S/C24H26ClNO2S2/c25-21-10-5-19(6-11-21)7-14-23(27)20-8-12-22(13-9-20)28-17-4-18-30-24(29)26-15-2-1-3-16-26/h5-14H,1-4,15-18H2/b14-7+

Standard InChI Key:  QWENHADYUHFDMO-VGOFMYFVSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   27.8670   -7.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5748   -6.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2825   -7.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5748   -5.9061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9902   -6.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6979   -7.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6956   -7.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4024   -8.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1111   -7.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1085   -7.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4011   -6.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1598   -6.7203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4526   -7.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4521   -7.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1648   -8.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8691   -7.9445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7450   -8.3559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0367   -7.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3295   -8.3577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6213   -7.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9141   -8.3596    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.2059   -7.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4987   -8.3615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2048   -7.1348    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.7943   -7.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0892   -8.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0861   -9.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7942   -9.5872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5054   -9.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8194   -8.3576    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  1 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16  1  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 23 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
  9 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4549246

    ---

Associated Targets(Human)

SK-N-SH (1499 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ECa-109 cell line (1254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.06Molecular Weight (Monoisotopic): 459.1093AlogP: 6.51#Rotatable Bonds: 8
Polar Surface Area: 29.54Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.65CX LogD: 6.65
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.19Np Likeness Score: -0.92

References

1. Fu DJ, Zhang SY, Liu YC, Zhang L, Liu JJ, Song J, Zhao RH, Li F, Sun HH, Liu HM, Zhang YB..  (2016)  Design, synthesis and antiproliferative activity studies of novel dithiocarbamate-chalcone derivates.,  26  (16): [PMID:27423479] [10.1016/j.bmcl.2016.07.012]

Source